Record Information
Version2.0
StatusDetected and Quantified
Creation Date2020-12-10 18:53:33 UTC
Update Date2025-10-07 16:04:13 UTC
Metabolite IDMMDBc0000723
Metabolite Identification
Common NameFucitol
DescriptionFucitol is a sugar alcohol belonging to the chemical class of polyols. Its chemical structure features a fucose moiety, which can be modified through various pathways, including sulfation, as indicated by the detection of 1, 3, 5-tri-O-acetyl-2, 4-di-O-methyl-L-fucitol and 1, 4, 5-tri-O-acetyl-2, 3-di-O-methyl-L-fucitol (PMID:37182947 ). In biological contexts, fucitol has been shown to rapidly lyse Microcystis aeruginosa cells, highlighting its potential role in cellular interactions (PMID:35495711 ). Furthermore, fucitol derivatives, such as 1-deoxyfuconojirimycin, act as fucosidase inhibitors, which are relevant in cancer research (PMID:30554081 ). The synthesis of 3-deoxy-3-fluoro-L-fucitol involves enzymatic oxidation of its precursor, showcasing its synthetic versatility (PMID:32390019 ). Additionally, fucitol is implicated in the formation of O-linked fucose structures associated with epidermal growth factor, as evidenced by its detection in LC-MS/MS analyses (PMID:22422444 ). Structural studies have also revealed interactions between fucitol and enzymes, such as Bacillus pallidus d-arabinose isomerase, providing insights into its biochemical roles (PMID:20123133 ).
Structure
SynonymsNot Available
Molecular FormulaC6H14O5
Average Mass166.1724
Monoisotopic Mass166.084123558
IUPAC Name(2R,3S,4S,5S)-hexane-1,2,3,4,5-pentol
Traditional Namefucitol
CAS Registry NumberNot Available
SMILES
C[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO
InChI Identifier
InChI=1S/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3/t3-,4+,5-,6-/m0/s1
InChI KeySKCKOFZKJLZSFA-FSIIMWSLSA-N