Record Information
Version1.0
StatusDetected and Quantified
Creation Date2020-12-10 18:53:59 UTC
Update Date2025-10-07 16:04:14 UTC
Metabolite IDMMDBc0000742
Metabolite Identification
Common NameMaleamate
DescriptionMaleamate is a metabolite classified within the category of amino acid derivatives. Its chemical structure features a maleic acid backbone, which is modified by the addition of an amine group, resulting in unique reactivity profiles. Maleamate plays a role in various biochemical pathways, including its involvement in the inhibition of fungal growth, as demonstrated by its ability to inhibit the growth of A. (PMID:38671402 ). Additionally, it has been utilized in bioconjugation techniques, specifically in the development of a maleamate-based prosthetic group for efficient, site-specific radioiodination of proteins and antibodies containing cysteine residues (PMID:38746876 ). Furthermore, maleamate is part of supramolecular structures, such as sodium N-(dehydroabietyl)maleamate/Ca2+ metallohydrogels, which exhibit multi-stimulus responsiveness to various environmental factors, showcasing its versatility in material science (PMID:37348017 ). Notably, maleamate levels have been positively correlated with the number of retrieved oocytes in patients undergoing ovarian hyperstimulation syndrome (OHSS), indicating its potential relevance in reproductive biology (PMID:36967756 ).
Structure
Synonyms
ValueSource
Maleamic acidGenerator
Molecular FormulaC4H4NO3
Average Mass114.081
Monoisotopic Mass114.019666573
IUPAC Name(2Z)-3-carboxyprop-2-enecarboximidate
Traditional Name(2Z)-3-carboxyprop-2-enecarboximidate
CAS Registry NumberNot Available
SMILES
OC(=O)\C=C/C([O-])=N
InChI Identifier
InChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/p-1/b2-1-
InChI KeyFSQQTNAZHBEJLS-UPHRSURJSA-M