Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 18:06:56 UTC
Update Date2025-10-07 16:04:23 UTC
Metabolite IDMMDBc0000858
Metabolite Identification
Common NameTerreulactone C
DescriptionTerreulactone C is a five α-pyrone meroterpenoid, a class of compounds that combines features of both terpenes and polyketides. Its chemical structure is characterized by a fused ring system that includes a pyrone moiety, contributing to its unique reactivity and potential biological activities. Terreulactone C, along with other meroterpenoids, is derived from the marine fungus Penicillium sp., showcasing the diverse chemical repertoire of marine-derived fungi (PMID:27067533 ). In terms of biochemical pathways, compounds like terreulactone C may participate in various metabolic processes, potentially influencing pathways related to secondary metabolite biosynthesis and cellular signaling. The presence of such metabolites often indicates ecological interactions and adaptations, although specific pathways involving terreulactone C remain to be fully elucidated. Overall, terreulactone C exemplifies the intricate chemistry found in natural products, reflecting the complex interplay between microbial biosynthesis and chemical diversity.
Structure
SynonymsNot Available
Molecular FormulaC27H32O7
Average Mass468.546
Monoisotopic Mass468.21480337
IUPAC Name7a,11b-dihydroxy-3-(4-methoxyphenyl)-5a,8,8,11a-tetramethyl-1,5a,6,7,7a,8,9,10,11,11a,11b,12-dodecahydro-2,5-dioxatetraphene-1,9-dione
Traditional Name7a,11b-dihydroxy-3-(4-methoxyphenyl)-5a,8,8,11a-tetramethyl-7,10,11,12-tetrahydro-6H-2,5-dioxatetraphene-1,9-dione
CAS Registry NumberNot Available
SMILES
COC1=CC=C(C=C1)C1=CC2=C(CC3(O)C(C)(CCC4(O)C(C)(C)C(=O)CCC34C)O2)C(=O)O1
InChI Identifier
InChI=1S/C27H32O7/c1-23(2)21(28)10-11-24(3)26(23,30)13-12-25(4)27(24,31)15-18-20(34-25)14-19(33-22(18)29)16-6-8-17(32-5)9-7-16/h6-9,14,30-31H,10-13,15H2,1-5H3
InChI KeyARZWKYJFXLHKCZ-UHFFFAOYSA-N