Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 18:40:18 UTC
Update Date2025-10-07 16:04:24 UTC
Metabolite IDMMDBc0000981
Metabolite Identification
Common NameSterenin M
DescriptionSterenin M is a secondary metabolite belonging to the class of natural products derived from mushrooms. Its chemical structure has not been explicitly detailed in the provided literature, but it is involved in various biochemical pathways, particularly in the context of viral inhibition. Sterenin M has been identified as a potential inhibitor of the SARS-CoV-2 main protease, a crucial enzyme for viral replication, through computational methods such as molecular docking and dynamics simulations (PMID:34174757 ). The metabolite exhibited favorable binding interactions and was evaluated for its absorption, distribution, metabolism, excretion, and toxicity (ADMET) profile, alongside binding energy calculations, which further supported its role as a SARS-CoV-2 main protease inhibitor (PMID:34174757 ). Additionally, Sterenin M was docked with RG4, revealing non-covalent interactions that may contribute to its biological activity (PMID:39611109 ). Given its promising properties, further validation through in vitro and in vivo studies is warranted to fully elucidate its potential therapeutic applications against SARS-CoV-2 (PMID:34174757 ).
Structure
SynonymsNot Available
Molecular FormulaC27H31NO8
Average Mass497.544
Monoisotopic Mass497.204966962
IUPAC Name2-[6-(2,4-dihydroxy-6-methylbenzoyloxy)-4-hydroxy-5-(3-methylbut-2-en-1-yl)-1-oxo-2,3-dihydro-1H-isoindol-2-yl]-4-methylpentanoic acid
Traditional Name2-[6-(2,4-dihydroxy-6-methylbenzoyloxy)-4-hydroxy-5-(3-methylbut-2-en-1-yl)-1-oxo-3H-isoindol-2-yl]-4-methylpentanoic acid
CAS Registry NumberNot Available
SMILES
CC(C)CC(N1CC2=C(O)C(CC=C(C)C)=C(OC(=O)C3=C(O)C=C(O)C=C3C)C=C2C1=O)C(O)=O
InChI Identifier
InChI=1S/C27H31NO8/c1-13(2)6-7-17-22(36-27(35)23-15(5)9-16(29)10-21(23)30)11-18-19(24(17)31)12-28(25(18)32)20(26(33)34)8-14(3)4/h6,9-11,14,20,29-31H,7-8,12H2,1-5H3,(H,33,34)
InChI KeyXZTGMLQCPNUZQT-UHFFFAOYSA-N