Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 18:41:57 UTC
Update Date2025-10-07 16:04:25 UTC
Metabolite IDMMDBc0001046
Metabolite Identification
Common NameSpirotryprostatin A
DescriptionSpirotryprostatin A is a member of the alkaloid chemical class, characterized by its complex bicyclic structure. It is synthesized through a series of chemical reactions, including enantioselective total synthesis that utilizes starting materials such as 2-iodo-5-methoxyaniline and γ-butyrolactone (PMID:36445815 ). The compound has garnered attention for its antifungal properties, as demonstrated by the synthesis and evaluation of various derivatives that exhibit broad-spectrum antifungal activity against multiple plant pathogens (PMID:38398616 ). Notably, molecular docking studies indicate that spirotryprostatin A derivatives interact with the binding site of succinate dehydrogenase (SDH), suggesting potential mechanisms of action (PMID:38398616 ). Additionally, spirotryprostatin A is biosynthesized from fumitremorgin C via the fumiquinazoline biosynthetic pathway, specifically through the action of the FqzB enzyme, which catalyzes the epoxidation process (PMID:33332106 ). The understanding of substrate recognition and tolerance exhibited by FqzB further elucidates the biochemical pathways involved in the formation of spirotryprostatin A (PMID:33332106 ).
Structure
SynonymsNot Available
Molecular FormulaC22H25N3O4
Average Mass395.459
Monoisotopic Mass395.184506297
IUPAC Name(3S,3'S,6'S,9'S)-2-hydroxy-6-methoxy-6'-(2-methylprop-1-en-1-yl)-1',7'-diazaspiro[indole-3,5'-tricyclo[7.3.0.0^{3,7}]dodecane]-2',8'-dione
Traditional Name(3S,3'S,6'S,9'S)-2-hydroxy-6-methoxy-6'-(2-methylprop-1-en-1-yl)-1',7'-diazaspiro[indole-3,5'-tricyclo[7.3.0.0^{3,7}]dodecane]-2',8'-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)[C@]1([H])C[C@@]3(C(O)=NC4=C3C=CC(OC)=C4)[C@]([H])(C=C(C)C)N1C2=O
InChI Identifier
InChI=1S/C22H25N3O4/c1-12(2)9-18-22(14-7-6-13(29-3)10-15(14)23-21(22)28)11-17-19(26)24-8-4-5-16(24)20(27)25(17)18/h6-7,9-10,16-18H,4-5,8,11H2,1-3H3,(H,23,28)/t16-,17-,18-,22-/m0/s1
InChI KeyMQJKGSIAJNXSCM-ORGXJRBJSA-N