Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 18:43:33 UTC
Update Date2025-10-07 16:04:25 UTC
Metabolite IDMMDBc0001107
Metabolite Identification
Common NameAsperpyrone B
DescriptionAsperpyrone B is a dimeric naphtho-γ-pyrone, a class of compounds characterized by their unique polycyclic structures and diverse biological activities. Chemically, Asperpyrone B features a complex arrangement of fused aromatic rings, which contributes to its potential bioactivity. It was first isolated from the endophytic fungus Alternaria alternata HE11, obtained from Colocasia esculanta leaves, alongside other metabolites such as Ergosterol and β-Sitosterol (PMID:37414961 ). Additionally, Asperpyrone B was also identified in the marine-derived fungus Aspergillus foetidus KMM 4694, where it was found among various other naphtho-γ-pyrones (PMID:31242774 ). In terms of biological pathways, dimeric naphtho-γ-pyrones like Asperpyrone B are known to be involved in various metabolic processes, potentially influencing fungal growth and secondary metabolite production, although specific pathways for Asperpyrone B have yet to be fully elucidated. The structural characteristics of Asperpyrone B suggest it may interact with biological targets, contributing to its role in the ecology of the fungi from which it is derived.
Structure
SynonymsNot Available
Molecular FormulaC32H26O10
Average Mass570.55
Monoisotopic Mass570.152597037
IUPAC Name5-hydroxy-6-{5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-benzo[h]chromen-9-yl}-8,10-dimethoxy-2-methyl-4H-benzo[h]chromen-4-one
Traditional Name5-hydroxy-6-{5-hydroxy-8,10-dimethoxy-2-methyl-4-oxobenzo[h]chromen-9-yl}-8,10-dimethoxy-2-methylbenzo[h]chromen-4-one
CAS Registry NumberNot Available
SMILES
COC1=CC(OC)=C2C3=C(C(=O)C=C(C)O3)C(O)=C(C2=C1)C1=C(OC)C=C2C=C(O)C3=C(OC(C)=CC3=O)C2=C1OC
InChI Identifier
InChI=1S/C32H26O10/c1-13-7-18(33)26-20(35)9-15-10-21(38-4)28(30(40-6)23(15)31(26)41-13)25-17-11-16(37-3)12-22(39-5)24(17)32-27(29(25)36)19(34)8-14(2)42-32/h7-12,35-36H,1-6H3
InChI KeyADLOVFYPOQTFMO-UHFFFAOYSA-N