Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 19:34:08 UTC
Update Date2025-10-07 16:04:27 UTC
Metabolite IDMMDBc0001289
Metabolite Identification
Common NameCR377
DescriptionCR377 is a pentaketide, a class of compounds characterized by their biosynthesis from five acetyl-CoA units. This metabolite was identified from the culture broth of an endophytic fungus, specifically a taxonomically unclassified strain of Fusarium, and exhibits notable antifungal properties, particularly against Candida albicans (PMID:11076576 ). The chemical structure of CR377 has been elucidated through advanced techniques including one-dimensional and two-dimensional nuclear magnetic resonance (NMR) spectroscopy and high-resolution fast atom bombardment mass spectrometry (HRFABMS) (PMID:11076576 ). Additionally, it has been shown that CR377 is identical to fujikurin A, a bioactive compound, while other related fujikurins B-D have not been documented in other fungal species (PMID:26192387 ). The pathways involving CR377 may include those that lead to the biosynthesis of antifungal agents, contributing to the organism's defense mechanisms against pathogens. Overall, CR377 represents a significant compound within the realm of natural products and antifungal research, highlighting the potential of endophytic fungi in drug discovery (PMID:12942035 ).
Structure
SynonymsNot Available
Molecular FormulaC12H16O4
Average Mass224.256
Monoisotopic Mass224.104858995
IUPAC Name4-hydroxy-6-methyl-3-(2-methylbutanoyl)-5-methylidene-5,6-dihydro-2H-pyran-2-one
Traditional Name4-hydroxy-6-methyl-3-(2-methylbutanoyl)-5-methylidene-6H-pyran-2-one
CAS Registry NumberNot Available
SMILES
CCC(C)C(=O)C1=C(O)C(=C)C(C)OC1=O
InChI Identifier
InChI=1S/C12H16O4/c1-5-6(2)10(13)9-11(14)7(3)8(4)16-12(9)15/h6,8,14H,3,5H2,1-2,4H3
InChI KeyMBIXEABLQIFDCJ-UHFFFAOYSA-N