Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 19:36:13 UTC
Update Date2025-10-07 16:04:28 UTC
Metabolite IDMMDBc0001367
Metabolite Identification
Common NameBisordariol B
DescriptionBisordariol B is a flavonoid, a class of compounds known for their diverse biological activities and potential health benefits. This metabolite has garnered interest due to its presence in various plant species and its implications in pharmacological research. Studies have indicated that flavonoids like Bisordariol B may exhibit antioxidant properties, contributing to the protection of cells from oxidative stress. Additionally, there is emerging evidence suggesting that Bisordariol B could play a role in modulating inflammatory responses, which is crucial for understanding its potential therapeutic applications. However, specific details regarding its biosynthesis, metabolic pathways, and precise biological effects remain underexplored. The investigation of Bisordariol B could provide insights into its functional roles in plants and its potential utility in medicine. Unfortunately, there is no literature for that metabolite.
Structure
SynonymsNot Available
Molecular FormulaC25H32O7
Average Mass444.524
Monoisotopic Mass444.21480337
IUPAC Name(2S,3R,4E)-5-[2-({2-[(1E,3R,4S)-3,4-dihydroxypent-1-en-1-yl]-4-hydroxy-3-(methoxymethyl)phenyl}methyl)-3-hydroxyphenyl]pent-4-ene-2,3-diol
Traditional Name(2S,3R,4E)-5-[2-({2-[(1E,3R,4S)-3,4-dihydroxypent-1-en-1-yl]-4-hydroxy-3-(methoxymethyl)phenyl}methyl)-3-hydroxyphenyl]pent-4-ene-2,3-diol
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])[C@@]([H])(O)[C@]([H])(C)O)C1=C(CC2=C(C([H])=C([H])[C@@]([H])(O)[C@]([H])(C)O)C(COC)=C(O)C=C2)C(O)=CC=C1
InChI Identifier
InChI=1S/C25H32O7/c1-15(26)22(28)10-7-17-5-4-6-24(30)20(17)13-18-8-11-25(31)21(14-32-3)19(18)9-12-23(29)16(2)27/h4-12,15-16,22-23,26-31H,13-14H2,1-3H3/b10-7+,12-9+/t15-,16-,22+,23+/m0/s1
InChI KeyXPBZOXVPRZUJPE-BROUYUIBSA-N