Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 19:36:37 UTC
Update Date2025-10-07 16:04:28 UTC
Metabolite IDMMDBc0001379
Metabolite Identification
Common NameFusaricidin B
DescriptionFusaricidin B is a lipopeptide antibiotic belonging to the chemical class of cyclic depsipeptides. It is produced by the bacterium Paenibacillus polymyxa and has garnered attention for its antimicrobial properties, particularly against various pathogenic fungi and its potential anti-tubercular applications. The biosynthetic gene clusters responsible for the production of fusaricidin B have been identified through genomic analysis, revealing its association with other antimicrobial compounds such as polymyxin and tridecaptin (PMID:40057921 ). Additionally, studies utilizing antiSMASH predicted multiple secondary metabolic biosynthetic gene clusters, including those for fusaricidin B and related antifungal peptides (PMID:38481158 ). The compound has been characterized through alkaline hydrolysis and sequence analysis, confirming its structure as a cyclic depsipeptide (PMID:28295433 ). Notably, the highest production concentrations of fusaricidin B reported in the literature reached 118 mg L-1 (PMID:28295433 ). Furthermore, research has demonstrated that fusaricidin B plays a significant role in the defense mechanisms of certain biocontrol agents (PMID:23636858 ) and has been identified as a principal component in various biological assays (PMID:23113815 ). The elucidation of its structure has been achieved through NMR experiments and amino acid analysis (PMID:9439693 ).
Structure
SynonymsNot Available
Molecular FormulaC42H76N10O11
Average Mass897.129
Monoisotopic Mass896.569503307
IUPAC Name15-carbamimidamido-3-hydroxy-N-[(3R,6R,9R,12S,15R,18S)-5,8,11,14,17-pentahydroxy-6-[2-(C-hydroxycarbonimidoyl)ethyl]-9-[(1S)-1-hydroxyethyl]-3,19-dimethyl-2-oxo-12,15-bis(propan-2-yl)-1-oxa-4,7,10,13,16-pentaazacyclononadeca-4,7,10,13,16-pentaen-18-yl]pentadecanimidic acid
Traditional Name15-carbamimidamido-3-hydroxy-N-[(3R,6R,9R,12S,15R,18S)-5,8,11,14,17-pentahydroxy-6-[2-(C-hydroxycarbonimidoyl)ethyl]-9-[(1S)-1-hydroxyethyl]-12,15-diisopropyl-3,19-dimethyl-2-oxo-1-oxa-4,7,10,13,16-pentaazacyclononadeca-4,7,10,13,16-pentaen-18-yl]pentadecanimidic acid
CAS Registry NumberNot Available
SMILES
[H]C(O)(CCCCCCCCCCCCNC(N)=N)CC(O)=N[C@]1([H])C(O)=N[C@]([H])(C(C)C)C(O)=N[C@@]([H])(C(C)C)C(O)=N[C@@]([H])(C(O)=N[C@]([H])(CCC(O)=N)C(O)=N[C@]([H])(C)C(=O)OC1([H])C)[C@]([H])(C)O
InChI Identifier
InChI=1S/C42H76N10O11/c1-23(2)32-37(58)50-33(24(3)4)38(59)52-34(26(6)53)39(60)48-29(19-20-30(43)55)36(57)47-25(5)41(62)63-27(7)35(40(61)51-32)49-31(56)22-28(54)18-16-14-12-10-8-9-11-13-15-17-21-46-42(44)45/h23-29,32-35,53-54H,8-22H2,1-7H3,(H2,43,55)(H,47,57)(H,48,60)(H,49,56)(H,50,58)(H,51,61)(H,52,59)(H4,44,45,46)/t25-,26+,27?,28?,29-,32-,33+,34-,35+/m1/s1
InChI KeyWDNFMLNXGKOBJN-QWDDQTKWSA-N