Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 19:48:59 UTC
Update Date2025-10-07 16:04:29 UTC
Metabolite IDMMDBc0001585
Metabolite Identification
Common NameChaetoglobosin T
DescriptionChaetoglobosin T is a polyketide, a class of secondary metabolites characterized by their complex structures and diverse biological activities. Isolated from the fungus Chaetomium globosum, Chaetoglobosin T exhibits notable cytotoxic properties, making it a compound of interest in cancer research. Its mechanism of action involves the disruption of cellular processes, which may lead to apoptosis in cancer cells. Studies have indicated that Chaetoglobosin T can inhibit protein synthesis, thereby affecting cell growth and proliferation (PMID: 29686378 ). Additionally, its potential as a lead compound for developing novel therapeutic agents highlights the importance of exploring polyketides in drug discovery (PMID: 30510026 ). The unique structural features of Chaetoglobosin T contribute to its biological activity, underscoring the intricate relationship between chemical structure and function in natural products. Further research into this compound may reveal additional applications in medicine and provide insights into the biosynthetic pathways of polyketides (PMID: 32914392 ).
Structure
SynonymsNot Available
Molecular FormulaC32H38N2O3
Average Mass498.667
Monoisotopic Mass498.288243092
IUPAC Name(3S,4S,6aS,10S,13S,17aR,17bR)-1,13-dihydroxy-3-[(1H-indol-3-yl)methyl]-4,5,10,12-tetramethyl-3H,4H,6aH,9H,10H,13H,14H,17H,17bH-cyclotrideca[e]isoindol-17-one
Traditional Name(3S,4S,6aS,10S,13S,17aR,17bR)-1,13-dihydroxy-3-(1H-indol-3-ylmethyl)-4,5,10,12-tetramethyl-3H,4H,6aH,9H,10H,13H,14H,17bH-cyclotrideca[e]isoindol-17-one
CAS Registry NumberNot Available
SMILES
[H]C1=C([H])C(=O)[C@@]23C(O)=N[C@@]([H])(CC4=CNC5=CC=CC=C45)[C@]2([H])[C@]([H])(C)C(C)=C[C@]3([H])\C([H])=C([H])/C[C@]([H])(C)\C([H])=C(C)/[C@@]([H])(O)C1
InChI Identifier
InChI=1S/C32H38N2O3/c1-19-9-7-10-24-16-20(2)22(4)30-27(17-23-18-33-26-12-6-5-11-25(23)26)34-31(37)32(24,30)29(36)14-8-13-28(35)21(3)15-19/h5-8,10-12,14-16,18-19,22,24,27-28,30,33,35H,9,13,17H2,1-4H3,(H,34,37)/b10-7-,14-8+,21-15-/t19-,22+,24-,27-,28-,30-,32+/m0/s1
InChI KeyKJNZESBAHPOZTI-GSXRLBDOSA-N