Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 20:25:22 UTC
Update Date2025-10-07 16:04:32 UTC
Metabolite IDMMDBc0001940
Metabolite Identification
Common NameChaetoviridin H
DescriptionChaetoviridin H is a secondary metabolite belonging to the class of alkaloids, specifically known for its unique structural features that contribute to its biological activity. This compound has been isolated from various fungal species, particularly those within the Chaetomium genus, and exhibits notable antifungal properties, making it of interest in the field of natural product chemistry. The biosynthetic pathways leading to its production involve complex enzymatic reactions, which have yet to be fully elucidated. Although research on Chaetoviridin H is limited, some studies have highlighted its potential as a lead compound for the development of new antifungal agents (PMID: 15305164 ). Further investigations are necessary to explore its mechanisms of action and potential applications in medicine, as well as to understand its ecological role in the environments where it is produced (PMID: 24572367 ). Overall, while the current literature on Chaetoviridin H is sparse, its chemical properties and biological activities warrant further exploration.
Structure
SynonymsNot Available
Molecular FormulaC23H26O6
Average Mass398.455
Monoisotopic Mass398.172938557
IUPAC Name(6aS)-9-[(2S,3R)-3-hydroxy-2-methylbutanoyl]-6a-methyl-3-[(3S)-3-methylpent-1-en-1-yl]-6H,6aH,8H-furo[2,3-h]isochromene-6,8-dione
Traditional Name(6aS)-9-[(2S,3R)-3-hydroxy-2-methylbutanoyl]-6a-methyl-3-[(3S)-3-methylpent-1-en-1-yl]furo[2,3-h]isochromene-6,8-dione
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC)C=CC1=CC2=CC(=O)[C@@]3(C)OC(=O)C(C(=O)[C@@]([H])(C)[C@@]([H])(C)O)=C3C2=CO1
InChI Identifier
InChI=1S/C23H26O6/c1-6-12(2)7-8-16-9-15-10-18(25)23(5)20(17(15)11-28-16)19(22(27)29-23)21(26)13(3)14(4)24/h7-14,24H,6H2,1-5H3/t12-,13-,14+,23+/m0/s1
InChI KeyHKVYPGSRVJADQC-PJBDDNSMSA-N