MiMeDB: Showing metabocard for Granadaene (MMDBc0002128)

Record Information

Version

2.0

Status

Detected and Quantified

Creation Date

2021-05-14 20:38:54 UTC

Update Date

2025-10-07 16:04:33 UTC

Metabolite ID

MMDBc0002128

Metabolite Identification

Common Name

Granadaene

Description

Granadaene is a cytotoxic lipid toxin classified as a metabolite, primarily associated with Group B Streptococcus (GBS). It exhibits cytotoxic effects on various immune cells, including T and B cells, highlighting its potential role in immune evasion during infections (PMID:37384812 ). The presence of granadaene in GBS strains, such as COH1 and NCTC, suggests its involvement in the pathogenesis of GBS diseases, particularly through its relationship with hemolysin/cytolysin (PMID:33502005 ). Interestingly, granadaene also has photophysical properties, acting as an endogenous chromophore that absorbs blue light, which can influence the susceptibility of GBS to antimicrobial treatments (PMID:33578336 ). Recent studies have identified edible insects as a potential reservoir for granadaene-producing lactococci, raising concerns about zoonotic risks associated with these bacteria (PMID:35615513 ). Furthermore, the use of synthetic analogs of granadaene, such as R-P4, has shown promise in reducing bacterial dissemination during systemic infections, indicating a potential therapeutic avenue (PMID:37384812 ). Overall, granadaene represents a significant factor in the virulence and pathogenicity of GBS, with implications for both microbiology and immunology.

Structure

MOL SDF PDB SMILES InChI


  Mrv1652305142122382D          

 73 73  0  0  0  0            999 V2000
  -28.0421    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.5171    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.3796   12.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.2046   12.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.9671   13.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.6171   12.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1421   13.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -21.4421   12.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.7296   14.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -21.8546   11.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.9046   14.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -22.6796   11.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.4921   15.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -23.0921   10.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6671   15.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -23.9171   10.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.2546   15.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -24.3296   10.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.4296   15.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -25.1546   10.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0171   16.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -25.5671    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.1921   16.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -26.3921    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7796   17.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0671   19.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -26.8046    8.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4796   18.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.9546   17.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2421   19.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -27.6296    8.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.1046    8.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3046   18.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5421   17.9586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.5171    7.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.1046    7.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -29.2796    7.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7171   19.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -28.8671    7.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8296   20.1020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7171   17.9586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.9546   18.6730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -31.3421    7.9560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -30.5171    6.5270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -28.8671    6.5270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5421   19.3875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3046   20.1020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -28.0421    7.9560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -29.2796    8.6704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -18.9671   12.2428    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -20.6171   13.6717    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -19.3796   14.3862    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -20.2046   11.5283    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -17.7296   12.9573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -21.8546   12.9573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1421   15.1007    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -21.4421   10.8138    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.4921   13.6717    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -23.0921   12.2428    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.9046   15.8151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -22.6796   10.0994    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.2546   14.3862    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -24.3296   11.5283    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6671   16.5296    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -23.9171    9.3849    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0171   15.1007    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -25.5671   10.8138    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.4296   17.2441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -25.1546    8.6704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7796   15.8151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -26.8046   10.0994    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.1921   17.9586    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5421   16.5296    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  4  1  0  0  0  0
  7  5  2  0  0  0  0
  8  6  2  0  0  0  0
  9  7  1  0  0  0  0
 10  8  1  0  0  0  0
 11  9  2  0  0  0  0
 12 10  2  0  0  0  0
 13 11  1  0  0  0  0
 14 12  1  0  0  0  0
 15 13  2  0  0  0  0
 16 14  2  0  0  0  0
 17 15  1  0  0  0  0
 18 16  1  0  0  0  0
 19 17  2  0  0  0  0
 20 18  2  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  2  0  0  0  0
 24 22  2  0  0  0  0
 25 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28 26  1  0  0  0  0
 29 25  2  0  0  0  0
 30 26  1  0  0  0  0
 31  1  1  0  0  0  0
 31 27  1  0  0  0  0
 32  2  1  0  0  0  0
 33 28  1  0  0  0  0
 34 29  1  0  0  0  0
 35 32  1  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 33  1  0  0  0  0
 39 37  1  0  0  0  0
 40 30  1  0  0  0  0
 41 33  1  4  0  0  0
 41 34  2  0  0  0  0
 42 34  1  0  0  0  0
 43 35  1  0  0  0  0
 44 36  1  0  0  0  0
 45 37  1  0  0  0  0
 46 38  2  0  0  0  0
 47 38  1  0  0  0  0
 48 31  1  0  0  0  0
 48 39  1  0  0  0  0
 49 32  1  0  0  0  0
 49 39  1  0  0  0  0
 50  3  1  0  0  0  0
 51  4  1  0  0  0  0
 52  5  1  0  0  0  0
 53  6  1  0  0  0  0
 54  7  1  0  0  0  0
 55  8  1  0  0  0  0
 56  9  1  0  0  0  0
 57 10  1  0  0  0  0
 58 11  1  0  0  0  0
 59 12  1  0  0  0  0
 60 13  1  0  0  0  0
 61 14  1  0  0  0  0
 62 15  1  0  0  0  0
 63 16  1  0  0  0  0
 64 17  1  0  0  0  0
 65 18  1  0  0  0  0
 66 19  1  0  0  0  0
 67 20  1  0  0  0  0
 68 21  1  0  0  0  0
 69 22  1  0  0  0  0
 70 23  1  0  0  0  0
 71 24  1  0  0  0  0
 72 25  1  0  0  0  0
 73 29  1  0  0  0  0
M  END


  Mrv1652305142122382D          

 73 73  0  0  0  0            999 V2000
  -28.0421    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.5171    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.3796   12.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.2046   12.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.9671   13.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -20.6171   12.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1421   13.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -21.4421   12.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.7296   14.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -21.8546   11.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.9046   14.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -22.6796   11.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.4921   15.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -23.0921   10.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6671   15.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -23.9171   10.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.2546   15.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -24.3296   10.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.4296   15.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -25.1546   10.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0171   16.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -25.5671    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.1921   16.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -26.3921    9.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7796   17.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0671   19.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -26.8046    8.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4796   18.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.9546   17.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2421   19.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -27.6296    8.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.1046    8.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3046   18.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5421   17.9586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.5171    7.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -30.1046    7.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -29.2796    7.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7171   19.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -28.8671    7.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8296   20.1020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7171   17.9586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.9546   18.6730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -31.3421    7.9560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -30.5171    6.5270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -28.8671    6.5270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5421   19.3875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3046   20.1020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -28.0421    7.9560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -29.2796    8.6704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -18.9671   12.2428    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -20.6171   13.6717    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -19.3796   14.3862    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -20.2046   11.5283    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -17.7296   12.9573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -21.8546   12.9573    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1421   15.1007    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -21.4421   10.8138    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.4921   13.6717    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -23.0921   12.2428    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.9046   15.8151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -22.6796   10.0994    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.2546   14.3862    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -24.3296   11.5283    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6671   16.5296    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -23.9171    9.3849    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0171   15.1007    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -25.5671   10.8138    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.4296   17.2441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -25.1546    8.6704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7796   15.8151    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -26.8046   10.0994    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.1921   17.9586    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5421   16.5296    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  4  1  0  0  0  0
  7  5  2  0  0  0  0
  8  6  2  0  0  0  0
  9  7  1  0  0  0  0
 10  8  1  0  0  0  0
 11  9  2  0  0  0  0
 12 10  2  0  0  0  0
 13 11  1  0  0  0  0
 14 12  1  0  0  0  0
 15 13  2  0  0  0  0
 16 14  2  0  0  0  0
 17 15  1  0  0  0  0
 18 16  1  0  0  0  0
 19 17  2  0  0  0  0
 20 18  2  0  0  0  0
 21 19  1  0  0  0  0
 22 20  1  0  0  0  0
 23 21  2  0  0  0  0
 24 22  2  0  0  0  0
 25 23  1  0  0  0  0
 27 24  1  0  0  0  0
 28 26  1  0  0  0  0
 29 25  2  0  0  0  0
 30 26  1  0  0  0  0
 31  1  1  0  0  0  0
 31 27  1  0  0  0  0
 32  2  1  0  0  0  0
 33 28  1  0  0  0  0
 34 29  1  0  0  0  0
 35 32  1  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 33  1  0  0  0  0
 39 37  1  0  0  0  0
 40 30  1  0  0  0  0
 41 33  1  4  0  0  0
 41 34  2  0  0  0  0
 42 34  1  0  0  0  0
 43 35  1  0  0  0  0
 44 36  1  0  0  0  0
 45 37  1  0  0  0  0
 46 38  2  0  0  0  0
 47 38  1  0  0  0  0
 48 31  1  0  0  0  0
 48 39  1  0  0  0  0
 49 32  1  0  0  0  0
 49 39  1  0  0  0  0
 50  3  1  0  0  0  0
 51  4  1  0  0  0  0
 52  5  1  0  0  0  0
 53  6  1  0  0  0  0
 54  7  1  0  0  0  0
 55  8  1  0  0  0  0
 56  9  1  0  0  0  0
 57 10  1  0  0  0  0
 58 11  1  0  0  0  0
 59 12  1  0  0  0  0
 60 13  1  0  0  0  0
 61 14  1  0  0  0  0
 62 15  1  0  0  0  0
 63 16  1  0  0  0  0
 64 17  1  0  0  0  0
 65 18  1  0  0  0  0
 66 19  1  0  0  0  0
 67 20  1  0  0  0  0
 68 21  1  0  0  0  0
 69 22  1  0  0  0  0
 70 23  1  0  0  0  0
 71 24  1  0  0  0  0
 72 25  1  0  0  0  0
 73 29  1  0  0  0  0
M  END
> <DATABASE_ID>
MMDBc0002128

> <DATABASE_NAME>
MIME

> <SMILES>
[H]\C(CC(C)OC1OC(C)C(O)C(O)C1O)=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])C(O)=NC(CCCN)C(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C39H52N2O8/c1-31(48-39-37(45)36(44)35(43)32(2)49-39)27-24-22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25-29-34(42)41-33(38(46)47)28-26-30-40/h3-25,29,31-33,35-37,39,43-45H,26-28,30,40H2,1-2H3,(H,41,42)(H,46,47)/b4-3+,7-5+,8-6+,11-9+,12-10+,15-13+,16-14+,19-17+,20-18+,23-21+,24-22+,29-25+

> <INCHI_KEY>
PPFISAQUKQQDHW-TYXFIOLASA-N

> <FORMULA>
C39H52N2O8

> <MOLECULAR_WEIGHT>
676.851

> <EXACT_MASS>
676.372366642

> <JCHEM_ACCEPTOR_COUNT>
10

> <JCHEM_ATOM_COUNT>
101

> <JCHEM_AVERAGE_POLARIZABILITY>
80.82862783783624

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
6

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5-amino-2-{[(2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E)-1-hydroxy-27-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]octacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaen-1-ylidene]amino}pentanoic acid

> <ALOGPS_LOGP>
2.95

> <JCHEM_LOGP>
2.822898863255368

> <ALOGPS_LOGS>
-5.76

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
1

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
6.527415743331555

> <JCHEM_PKA_STRONGEST_ACIDIC>
3.904613553097053

> <JCHEM_PKA_STRONGEST_BASIC>
10.20118040830885

> <JCHEM_POLAR_SURFACE_AREA>
175.05999999999997

> <JCHEM_REFRACTIVITY>
208.8179000000001

> <JCHEM_ROTATABLE_BOND_COUNT>
21

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.17e-03 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5-amino-2-{[(2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E)-1-hydroxy-27-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]octacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaen-1-ylidene]amino}pentanoic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HEADER    PROTEIN                                 14-MAY-21   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   14-MAY-21         0                                  
HETATM    1  C   UNK     0     -52.345  17.518   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0     -56.965  17.518   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0     -36.175  24.187   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0     -37.715  24.187   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0     -35.405  25.521   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0     -38.485  22.853   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0     -33.865  25.521   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0     -40.025  22.853   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0     -33.095  26.854   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0     -40.795  21.520   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0     -31.555  26.854   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0     -42.335  21.520   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0     -30.785  28.188   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0     -43.105  20.186   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0     -29.245  28.188   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0     -44.645  20.186   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0     -28.475  29.522   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0     -45.415  18.852   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0     -26.935  29.522   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0     -46.955  18.852   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0     -26.165  30.855   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0     -47.725  17.518   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0     -24.625  30.855   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0     -49.265  17.518   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0     -23.855  32.189   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0     -16.925  36.190   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0     -50.035  16.185   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0     -17.695  34.856   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0     -22.315  32.189   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0     -15.385  36.190   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0     -51.575  16.185   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0     -56.195  16.185   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0     -19.235  34.856   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0     -21.545  33.523   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0     -56.965  14.851   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0     -56.195  13.517   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0     -54.655  13.517   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0     -20.005  36.190   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0     -53.885  14.851   0.000  0.00  0.00           C+0
HETATM   40  N   UNK     0     -14.615  37.524   0.000  0.00  0.00           N+0
HETATM   41  N   UNK     0     -20.005  33.523   0.000  0.00  0.00           N+0
HETATM   42  O   UNK     0     -22.315  34.856   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0     -58.505  14.851   0.000  0.00  0.00           O+0
HETATM   44  O   UNK     0     -56.965  12.184   0.000  0.00  0.00           O+0
HETATM   45  O   UNK     0     -53.885  12.184   0.000  0.00  0.00           O+0
HETATM   46  O   UNK     0     -21.545  36.190   0.000  0.00  0.00           O+0
HETATM   47  O   UNK     0     -19.235  37.524   0.000  0.00  0.00           O+0
HETATM   48  O   UNK     0     -52.345  14.851   0.000  0.00  0.00           O+0
HETATM   49  O   UNK     0     -54.655  16.185   0.000  0.00  0.00           O+0
HETATM   50  H   UNK     0     -35.405  22.853   0.000  0.00  0.00           H+0
HETATM   51  H   UNK     0     -38.485  25.521   0.000  0.00  0.00           H+0
HETATM   52  H   UNK     0     -36.175  26.854   0.000  0.00  0.00           H+0
HETATM   53  H   UNK     0     -37.715  21.520   0.000  0.00  0.00           H+0
HETATM   54  H   UNK     0     -33.095  24.187   0.000  0.00  0.00           H+0
HETATM   55  H   UNK     0     -40.795  24.187   0.000  0.00  0.00           H+0
HETATM   56  H   UNK     0     -33.865  28.188   0.000  0.00  0.00           H+0
HETATM   57  H   UNK     0     -40.025  20.186   0.000  0.00  0.00           H+0
HETATM   58  H   UNK     0     -30.785  25.521   0.000  0.00  0.00           H+0
HETATM   59  H   UNK     0     -43.105  22.853   0.000  0.00  0.00           H+0
HETATM   60  H   UNK     0     -31.555  29.522   0.000  0.00  0.00           H+0
HETATM   61  H   UNK     0     -42.335  18.852   0.000  0.00  0.00           H+0
HETATM   62  H   UNK     0     -28.475  26.854   0.000  0.00  0.00           H+0
HETATM   63  H   UNK     0     -45.415  21.520   0.000  0.00  0.00           H+0
HETATM   64  H   UNK     0     -29.245  30.855   0.000  0.00  0.00           H+0
HETATM   65  H   UNK     0     -44.645  17.518   0.000  0.00  0.00           H+0
HETATM   66  H   UNK     0     -26.165  28.188   0.000  0.00  0.00           H+0
HETATM   67  H   UNK     0     -47.725  20.186   0.000  0.00  0.00           H+0
HETATM   68  H   UNK     0     -26.935  32.189   0.000  0.00  0.00           H+0
HETATM   69  H   UNK     0     -46.955  16.185   0.000  0.00  0.00           H+0
HETATM   70  H   UNK     0     -23.855  29.522   0.000  0.00  0.00           H+0
HETATM   71  H   UNK     0     -50.035  18.852   0.000  0.00  0.00           H+0
HETATM   72  H   UNK     0     -24.625  33.523   0.000  0.00  0.00           H+0
HETATM   73  H   UNK     0     -21.545  30.855   0.000  0.00  0.00           H+0
CONECT    1   31                                                            
CONECT    2   32                                                            
CONECT    3    4    5   50                                                  
CONECT    4    3    6   51                                                  
CONECT    5    3    7   52                                                  
CONECT    6    4    8   53                                                  
CONECT    7    5    9   54                                                  
CONECT    8    6   10   55                                                  
CONECT    9    7   11   56                                                  
CONECT   10    8   12   57                                                  
CONECT   11    9   13   58                                                  
CONECT   12   10   14   59                                                  
CONECT   13   11   15   60                                                  
CONECT   14   12   16   61                                                  
CONECT   15   13   17   62                                                  
CONECT   16   14   18   63                                                  
CONECT   17   15   19   64                                                  
CONECT   18   16   20   65                                                  
CONECT   19   17   21   66                                                  
CONECT   20   18   22   67                                                  
CONECT   21   19   23   68                                                  
CONECT   22   20   24   69                                                  
CONECT   23   21   25   70                                                  
CONECT   24   22   27   71                                                  
CONECT   25   23   29   72                                                  
CONECT   26   28   30                                                       
CONECT   27   24   31                                                       
CONECT   28   26   33                                                       
CONECT   29   25   34   73                                                  
CONECT   30   26   40                                                       
CONECT   31    1   27   48                                                  
CONECT   32    2   35   49                                                  
CONECT   33   28   38   41                                                  
CONECT   34   29   41   42                                                  
CONECT   35   32   36   43                                                  
CONECT   36   35   37   44                                                  
CONECT   37   36   39   45                                                  
CONECT   38   33   46   47                                                  
CONECT   39   37   48   49                                                  
CONECT   40   30                                                            
CONECT   41   33   34                                                       
CONECT   42   34                                                            
CONECT   43   35                                                            
CONECT   44   36                                                            
CONECT   45   37                                                            
CONECT   46   38                                                            
CONECT   47   38                                                            
CONECT   48   31   39                                                       
CONECT   49   32   39                                                       
CONECT   50    3                                                            
CONECT   51    4                                                            
CONECT   52    5                                                            
CONECT   53    6                                                            
CONECT   54    7                                                            
CONECT   55    8                                                            
CONECT   56    9                                                            
CONECT   57   10                                                            
CONECT   58   11                                                            
CONECT   59   12                                                            
CONECT   60   13                                                            
CONECT   61   14                                                            
CONECT   62   15                                                            
CONECT   63   16                                                            
CONECT   64   17                                                            
CONECT   65   18                                                            
CONECT   66   19                                                            
CONECT   67   20                                                            
CONECT   68   21                                                            
CONECT   69   22                                                            
CONECT   70   23                                                            
CONECT   71   24                                                            
CONECT   72   25                                                            
CONECT   73   29                                                            
MASTER        0    0    0    0    0    0    0    0   73    0  146    0
END

Synonyms

Not Available

Molecular Formula

C₃₉H₅₂N₂O₈

Average Mass

676.851

Monoisotopic Mass

676.372366642

IUPAC Name

5-amino-2-{[(2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E)-1-hydroxy-27-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]octacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaen-1-ylidene]amino}pentanoic acid

Traditional Name

5-amino-2-{[(2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E)-1-hydroxy-27-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]octacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaen-1-ylidene]amino}pentanoic acid

CAS Registry Number

Not Available

SMILES

[H]\C(CC(C)OC1OC(C)C(O)C(O)C1O)=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])C(O)=NC(CCCN)C(O)=O

InChI Identifier

InChI=1S/C39H52N2O8/c1-31(48-39-37(45)36(44)35(43)32(2)49-39)27-24-22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25-29-34(42)41-33(38(46)47)28-26-30-40/h3-25,29,31-33,35-37,39,43-45H,26-28,30,40H2,1-2H3,(H,41,42)(H,46,47)/b4-3+,7-5+,8-6+,11-9+,12-10+,15-13+,16-14+,19-17+,20-18+,23-21+,24-22+,29-25+

InChI Key

PPFISAQUKQQDHW-TYXFIOLASA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as fatty acyl glycosides of mono- and disaccharides. Fatty acyl glycosides of mono- and disaccharides are compounds composed of a mono- or disaccharide moiety linked to one hydroxyl group of a fatty alcohol or of a phosphorylated alcohol (phosphoprenols), a hydroxy fatty acid or to one carboxyl group of a fatty acid (ester linkage) or to an amino alcohol.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Fatty Acyls

Sub Class

Fatty acyl glycosides

Direct Parent

Fatty acyl glycosides of mono- and disaccharides

Alternative Parents

Substituents

Fatty acyl glycoside of mono- or disaccharide
N-acyl-alpha-amino acid
N-acyl-alpha amino acid or derivatives
Alkyl glycoside
Hexose monosaccharide
Glycosyl compound
O-glycosyl compound
Alpha-amino acid or derivatives
Heterocyclic fatty acid
Hydroxy fatty acid
Monosaccharide
N-acyl-amine
Oxane
Amino acid or derivatives
Carboxamide group
Amino acid
Secondary carboxylic acid amide
Secondary alcohol
Polyol
Acetal
Carboxylic acid derivative
Carboxylic acid
Oxacycle
Monocarboxylic acid or derivatives
Organoheterocyclic compound
Organic oxide
Organopnictogen compound
Primary amine
Organooxygen compound
Alcohol
Carbonyl group
Hydrocarbon derivative
Organic oxygen compound
Primary aliphatic amine
Amine
Organonitrogen compound
Organic nitrogen compound
Aliphatic heteromonocyclic compound

Molecular Framework

Aliphatic heteromonocyclic compounds

External Descriptors

Not Available

Functional Ontology

Not Available

Physical Properties

State

Expected Solid

Predicted Properties

Property	Value	Source
Water Solubility	0.0012 g/L	ALOGPS
logP	2.95	ALOGPS
logP	2.82	ChemAxon
logS	-5.8	ALOGPS
pKa (Strongest Acidic)	3.9	ChemAxon
pKa (Strongest Basic)	10.2	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	10	ChemAxon
Hydrogen Donor Count	6	ChemAxon
Polar Surface Area	175.06 Å²	ChemAxon
Rotatable Bond Count	21	ChemAxon
Refractivity	208.82 m³·mol⁻¹	ChemAxon
Polarizability	80.83 Å³	ChemAxon
Number of Rings	1	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Spectra

Not Available

Chromatographic Retention Times and Retention Indices

Retention Times

Chromatography Type	Technique	Column	Deposition Date	Retention Time (s)
Liquid Chromatography	HILIC	Waters Acquity UPLC-BEH Amide column (eluted)	2025-10-23	201.8
Liquid Chromatography	HILIC	Accucore 150 Amide HILIC (eluted)	2025-10-23	65.4
Liquid Chromatography	Reversed-phase	Hypersil Gold 1.9 µm C18 (eluted)	2025-10-23	934.8
Liquid Chromatography	Reversed-phase	Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) (eluted)	2025-10-23	523.2
Liquid Chromatography	Reversed-phase	XBridge C18 3.5u 2.1x50 mm (eluted)	2025-10-23	1013.1
Liquid Chromatography	Reversed-phase	Ascentis Express C18 (void)	2025-10-23	312.8
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-23	4021.9
Liquid Chromatography	HILIC	Merck SeQuant ZIC-HILIC (eluted)	2025-10-23	229.3
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC (eluted)	2025-10-23	634.2
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-23	872.6
Liquid Chromatography	HILIC	Merck SeQuant ZIC-HILIC (eluted)	2025-10-23	242.4
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC HSS T3 C18 (eluted)	2025-10-23	235.1
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-23	217.9
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC column (eluted)	2025-10-23	10.7
Liquid Chromatography	HILIC	Merck SeQuant ZIC-pHILIC column (eluted)	2025-10-23	228.3
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-23	283.0
Liquid Chromatography	Reversed-phase	Waters ACQUITY UPLC BEH C18 (eluted)	2025-10-23	623.5
Liquid Chromatography	Reversed-phase	Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex (eluted)	2025-10-23	1542.3
Liquid Chromatography	Reversed-phase	Waters Atlantis T3 (2.1 x 150 mm, 5 um) (eluted)	2025-10-23	2256.8

Retention Indices

Chromatography Type	Peak Label	SMILES	Stationary Phase	Deposition Date	Retention Index
Gas Chromatography	Granadaene_TMS_1	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	903.948
Gas Chromatography	Granadaene_TMS_2	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1259.23
Gas Chromatography	Granadaene_TMS_3	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	1640.36
Gas Chromatography	Granadaene_TMS_4	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	2385.45
Gas Chromatography	Granadaene_TMS_5	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	1876.45
Gas Chromatography	Granadaene_TMS_6	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	2391.24
Gas Chromatography	Granadaene_TMS_7	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	2564.72
Gas Chromatography	Granadaene_TMS_8	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	2189.0
Gas Chromatography	Granadaene_TMS_9	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1959.19
Gas Chromatography	Granadaene_TMS_10	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	859.242
Gas Chromatography	Granadaene_TMS_11	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	489.011
Gas Chromatography	Granadaene_TMS_12	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	503.848
Gas Chromatography	Granadaene_TMS_13	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1272.7
Gas Chromatography	Granadaene_TMS_14	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard non polar	2025-10-23	2308.69
Gas Chromatography	Granadaene_TMS_15	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	881.666
Gas Chromatography	Granadaene_TMS_16	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	1170.86
Gas Chromatography	Granadaene_TMS_17	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	979.883
Gas Chromatography	Granadaene_TMS_18	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	1363.32
Gas Chromatography	Granadaene_TMS_19	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	521.231
Gas Chromatography	Granadaene_TMS_20	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	1664.1
Gas Chromatography	Granadaene_TMS_21	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	2805.77
Gas Chromatography	Granadaene_TMS_22	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	2562.6
Gas Chromatography	Granadaene_TMS_23	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	1888.25
Gas Chromatography	Granadaene_TMS_24	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1763.48
Gas Chromatography	Granadaene_TMS_25	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	2057.49
Gas Chromatography	Granadaene_TMS_26	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	1891.95
Gas Chromatography	Granadaene_TMS_27	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1301.57
Gas Chromatography	Granadaene_TMS_28	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	1156.4
Gas Chromatography	Granadaene_TMS_29	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	3367.36
Gas Chromatography	Granadaene_TMS_30	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard non polar	2025-10-23	1182.47
Gas Chromatography	Granadaene_TMS_31	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	3051.44
Gas Chromatography	Granadaene_TMS_32	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	2750.78
Gas Chromatography	Granadaene_TMS_33	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard non polar	2025-10-23	3318.12
Gas Chromatography	Granadaene_TMS_34	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	3786.46
Gas Chromatography	Granadaene_TMS_35	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard non polar	2025-10-23	1138.1
Gas Chromatography	Granadaene_TMS_36	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1725.34
Gas Chromatography	Granadaene_TMS_37	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard non polar	2025-10-23	809.608
Gas Chromatography	Granadaene_TMS_38	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	1272.53
Gas Chromatography	Granadaene_TMS_39	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard non polar	2025-10-23	705.626
Gas Chromatography	Granadaene_TMS_40	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard non polar	2025-10-23	2540.89
Gas Chromatography	Granadaene_TMS_41	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	1640.5
Gas Chromatography	Granadaene_TMS_42	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	2706.4
Gas Chromatography	Granadaene_TMS_43	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	3868.61
Gas Chromatography	Granadaene_TMS_44	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard non polar	2025-10-23	506.423
Gas Chromatography	Granadaene_TMS_45	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	1917.07
Gas Chromatography	Granadaene_TMS_46	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	2816.82
Gas Chromatography	Granadaene_TMS_47	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard non polar	2025-10-23	2427.59
Gas Chromatography	Granadaene_TMS_1	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2228.35
Gas Chromatography	Granadaene_TMS_2	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	2089.38
Gas Chromatography	Granadaene_TMS_3	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	2449.05
Gas Chromatography	Granadaene_TMS_4	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	2507.64
Gas Chromatography	Granadaene_TMS_5	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	1132.55
Gas Chromatography	Granadaene_TMS_6	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	2297.4
Gas Chromatography	Granadaene_TMS_7	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2039.63
Gas Chromatography	Granadaene_TMS_8	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2230.67
Gas Chromatography	Granadaene_TMS_9	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	1258.54
Gas Chromatography	Granadaene_TMS_10	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	3366.27
Gas Chromatography	Granadaene_TMS_11	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2592.7
Gas Chromatography	Granadaene_TMS_12	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	2251.93
Gas Chromatography	Granadaene_TMS_13	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	3024.8
Gas Chromatography	Granadaene_TMS_14	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard polar	2025-10-23	2202.8
Gas Chromatography	Granadaene_TMS_15	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	744.996
Gas Chromatography	Granadaene_TMS_16	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	2561.43
Gas Chromatography	Granadaene_TMS_17	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	2661.37
Gas Chromatography	Granadaene_TMS_18	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	851.116
Gas Chromatography	Granadaene_TMS_19	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	1528.71
Gas Chromatography	Granadaene_TMS_20	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	3892.52
Gas Chromatography	Granadaene_TMS_21	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	2327.46
Gas Chromatography	Granadaene_TMS_22	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	1763.06
Gas Chromatography	Granadaene_TMS_23	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2492.61
Gas Chromatography	Granadaene_TMS_24	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	3125.74
Gas Chromatography	Granadaene_TMS_25	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	1884.34
Gas Chromatography	Granadaene_TMS_26	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2087.67
Gas Chromatography	Granadaene_TMS_27	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	513.283
Gas Chromatography	Granadaene_TMS_28	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	2446.06
Gas Chromatography	Granadaene_TMS_29	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	2191.47
Gas Chromatography	Granadaene_TMS_30	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard polar	2025-10-23	3876.49
Gas Chromatography	Granadaene_TMS_31	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	2524.24
Gas Chromatography	Granadaene_TMS_32	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	1348.72
Gas Chromatography	Granadaene_TMS_33	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O[Si](C)(C)C)C(O)C1O	standard polar	2025-10-23	3695.65
Gas Chromatography	Granadaene_TMS_34	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	1419.43
Gas Chromatography	Granadaene_TMS_35	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard polar	2025-10-23	2778.02
Gas Chromatography	Granadaene_TMS_36	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	97.4772
Gas Chromatography	Granadaene_TMS_37	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard polar	2025-10-23	1529.2
Gas Chromatography	Granadaene_TMS_38	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	955.159
Gas Chromatography	Granadaene_TMS_39	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	standard polar	2025-10-23	2969.55
Gas Chromatography	Granadaene_TMS_40	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O[Si](C)(C)C)C1O	standard polar	2025-10-23	1691.07
Gas Chromatography	Granadaene_TMS_41	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	1940.27
Gas Chromatography	Granadaene_TMS_42	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	4120.91
Gas Chromatography	Granadaene_TMS_43	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	3423.77
Gas Chromatography	Granadaene_TMS_44	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)OC1OC(C)C(O)C(O)C1O[Si](C)(C)C	standard polar	2025-10-23	2548.73
Gas Chromatography	Granadaene_TMS_45	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	2715.2
Gas Chromatography	Granadaene_TMS_46	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	1533.14
Gas Chromatography	Granadaene_TMS_47	CC(C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(O)=NC(CCCN([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC1OC(C)C(O)C(O)C1O	standard polar	2025-10-23	711.287

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Associated OMIM IDs

114500 (Colorectal cancer)
610247 (Eosinophilic esophagitis)

Human Proteins and Enzymes

Protein ID	Protein Name	Protein Type	Uniprot ID	Species

Human Pathways

Pathways

Name	SMPDB/PathBank

Microbial Pathways

Pathways

Not Available

Metabolic Reactions

Reactions

This table shows at most 20 reactions. For the full list of associated reactions:

See All Associated Reactions

Reaction ID	Precursor	Product	Enzyme	Reaction Type	Data Source	Reference

Health Effects and Bioactivity

Health Outcome/Bioactivity	Metabolite Response/Effect	Evidence Type	Host and Biospecimen	Data Source	Reference

Microbial Sources

Superkingdom/Kingdom	Phylum	Total species	Hosts and Body Sites	Microbial Links
Bacteria/Eubacteria	Firmicutes	1	Human ; Human feces	Metabolic reconstruction

Exposure Sources

Other Exposures

Source Type	Data Source	Reference

Host Biospecimen and Location

Host and Biospecimen	Status	Mean	Std	Min	Max	Units	Age	Sex	Health Condition	Data Source	Reference

External Links

HMDB ID

Not Available

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

78444511

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Granadaene

METLIN ID

Not Available

PubChem Compound

139583456

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

CMMC Knowledgebase

Not Available

General References

van Santen JA, Poynton EF, Iskakova D, McMann E, Alsup TA, Clark TN, Fergusson CH, Fewer DP, Hughes AH, McCadden CA, Parra J, Soldatou S, Rudolf JD, Janssen EM, Duncan KR, Linington RG: The Natural Products Atlas 2.0: a database of microbially-derived natural products. Nucleic Acids Res. 2022 Jan 7;50(D1):D1317-D1323. doi: 10.1093/nar/gkab941. [PubMed:34718710 ]

Showing metabocard for Granadaene (MMDBc0002128)

MOL for #<Metabolite:0x00007f9ab6734620>

3D MOL for #<Metabolite:0x00007f9ab6734620>

3D SDF for #<Metabolite:0x00007f9ab6734620>

3D-SDF for #<Metabolite:0x00007f9ab6734620>

PDB for #<Metabolite:0x00007f9ab6734620>

3D PDB for #<Metabolite:0x00007f9ab6734620>

SMILES for #<Metabolite:0x00007f9ab6734620>

INCHI for #<Metabolite:0x00007f9ab6734620>

Structure for #<Metabolite:0x00007f9ab6734620>

3D Structure for #<Metabolite:0x00007f9ab6734620>