Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 20:38:54 UTC
Update Date2025-10-07 16:04:33 UTC
Metabolite IDMMDBc0002128
Metabolite Identification
Common NameGranadaene
DescriptionGranadaene is a cytotoxic lipid toxin classified as a metabolite, primarily associated with Group B Streptococcus (GBS). It exhibits cytotoxic effects on various immune cells, including T and B cells, highlighting its potential role in immune evasion during infections (PMID:37384812 ). The presence of granadaene in GBS strains, such as COH1 and NCTC, suggests its involvement in the pathogenesis of GBS diseases, particularly through its relationship with hemolysin/cytolysin (PMID:33502005 ). Interestingly, granadaene also has photophysical properties, acting as an endogenous chromophore that absorbs blue light, which can influence the susceptibility of GBS to antimicrobial treatments (PMID:33578336 ). Recent studies have identified edible insects as a potential reservoir for granadaene-producing lactococci, raising concerns about zoonotic risks associated with these bacteria (PMID:35615513 ). Furthermore, the use of synthetic analogs of granadaene, such as R-P4, has shown promise in reducing bacterial dissemination during systemic infections, indicating a potential therapeutic avenue (PMID:37384812 ). Overall, granadaene represents a significant factor in the virulence and pathogenicity of GBS, with implications for both microbiology and immunology.
Structure
SynonymsNot Available
Molecular FormulaC39H52N2O8
Average Mass676.851
Monoisotopic Mass676.372366642
IUPAC Name5-amino-2-{[(2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E)-1-hydroxy-27-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]octacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaen-1-ylidene]amino}pentanoic acid
Traditional Name5-amino-2-{[(2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E)-1-hydroxy-27-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]octacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaen-1-ylidene]amino}pentanoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(CC(C)OC1OC(C)C(O)C(O)C1O)=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])C(O)=NC(CCCN)C(O)=O
InChI Identifier
InChI=1S/C39H52N2O8/c1-31(48-39-37(45)36(44)35(43)32(2)49-39)27-24-22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25-29-34(42)41-33(38(46)47)28-26-30-40/h3-25,29,31-33,35-37,39,43-45H,26-28,30,40H2,1-2H3,(H,41,42)(H,46,47)/b4-3+,7-5+,8-6+,11-9+,12-10+,15-13+,16-14+,19-17+,20-18+,23-21+,24-22+,29-25+
InChI KeyPPFISAQUKQQDHW-TYXFIOLASA-N