Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 20:41:11 UTC
Update Date2025-10-07 16:04:34 UTC
Metabolite IDMMDBc0002211
Metabolite Identification
Common NameSequoiatone B
DescriptionSequoiatone B is a polyketide, a class of secondary metabolites characterized by their complex structures derived from the polymerization of acetyl-CoA units. This compound has been identified through comprehensive NMR and mass spectrometry analyses, confirming its planar structure as consistent with that of sequoiatone B (PMID:28303222 ). It was isolated from the Penicillium species alongside other polyketides and known compounds, including leptosphaerone C, penicillenone, arugosin I, and sequoiatone A, highlighting its significance within this chemical class (PMID:18067932 ). Polyketides like sequoiatone B are of considerable interest due to their diverse biological activities, which may include antimicrobial and antifungal properties, contributing to the ecological roles of the fungi from which they are derived. The structural elucidation and isolation of sequoiatone B not only enhance our understanding of fungal metabolism but also open avenues for potential applications in pharmaceuticals and biotechnology.
Structure
SynonymsNot Available
Molecular FormulaC22H30O5
Average Mass374.477
Monoisotopic Mass374.209324066
IUPAC Namemethyl (6Z,7S)-7-hydroxy-3,7-dimethyl-6-[(3R)-3-methyl-2-oxononylidene]-6H,7H-cyclopenta[c]pyran-5-carboxylate
Traditional Namemethyl (6Z,7S)-7-hydroxy-3,7-dimethyl-6-[(3R)-3-methyl-2-oxononylidene]cyclopenta[c]pyran-5-carboxylate
CAS Registry NumberNot Available
SMILES
[H]\C(C(=O)[C@]([H])(C)CCCCCC)=C1/C(C(=O)OC)=C2C=C(C)OC=C2[C@@]1(C)O
InChI Identifier
InChI=1S/C22H30O5/c1-6-7-8-9-10-14(2)19(23)12-17-20(21(24)26-5)16-11-15(3)27-13-18(16)22(17,4)25/h11-14,25H,6-10H2,1-5H3/b17-12-/t14-,22+/m1/s1
InChI KeyAZRKTTNHSKOLMR-ZFKUNJMVSA-N