Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 20:46:08 UTC
Update Date2025-10-07 16:04:34 UTC
Metabolite IDMMDBc0002322
Metabolite Identification
Common NameA-500359 H
DescriptionA-500359 H is a deaminocaprolactam derivative of capuramycin, classified within the chemical class of lactams. This compound, along with its analogs A-500359 F and A-500359 E, was isolated from the culture filtrate of specific microbial strains, highlighting its potential significance in microbial metabolism. The structural elucidation of A-500359 H reveals it as a 3'-demethyl derivative of A-500359 F, indicating modifications that may influence its biological activity. The study of these metabolites, including A-500359 H, contributes to the understanding of their roles in microbial ecology and potential therapeutic applications, particularly in the context of antibiotic development. The exploration of such compounds is crucial as they may possess unique properties that could be harnessed in treating various diseases, showcasing the intersection of chemistry and biology in drug discovery. (PMID:12760682 )
Structure
SynonymsNot Available
Molecular FormulaC16H19N3O12
Average Mass445.337
Monoisotopic Mass445.096873064
IUPAC Name(2R,3S,4R)-2-[(S)-[(3S,4R,5R)-3,4-dihydroxy-5-(4-hydroxy-2-oxo-1,2-dihydropyrimidin-1-yl)oxolan-2-yl](C-hydroxycarbonimidoyl)methoxy]-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
Traditional Name(4R,5S,6R)-6-[(S)-[(3S,4R,5R)-3,4-dihydroxy-5-(4-hydroxy-2-oxopyrimidin-1-yl)oxolan-2-yl](C-hydroxycarbonimidoyl)methoxy]-4,5-dihydroxy-5,6-dihydro-4H-pyran-2-carboxylic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](O[C@]1([H])OC(=C[C@@]([H])(O)[C@]1([H])O)C(O)=O)(C(O)=N)C1([H])O[C@@]([H])(N2C=CC(O)=NC2=O)[C@]([H])(O)[C@]1([H])O
InChI Identifier
InChI=1S/C16H19N3O12/c17-12(25)11(31-15-7(22)4(20)3-5(29-15)14(26)27)10-8(23)9(24)13(30-10)19-2-1-6(21)18-16(19)28/h1-4,7-11,13,15,20,22-24H,(H2,17,25)(H,26,27)(H,18,21,28)/t4-,7+,8+,9-,10?,11+,13-,15+/m1/s1
InChI KeyIHFPUFPCUYMJRS-JPNWODIXSA-N