Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 20:50:25 UTC
Update Date2025-10-07 16:04:35 UTC
Metabolite IDMMDBc0002474
Metabolite Identification
Common NameBacillithiol
DescriptionBacillithiol is a thiol metabolite classified as a low-molecular-weight thiol compound, primarily found in certain bacterial species, particularly within the Bacillus genus. It plays a crucial role in redox homeostasis and acts as a reactive oxygen species (ROS) scavenger, similar to glutathione in eukaryotes. Bacillithiol is involved in various biochemical processes, including the reductive activation of disulfide-containing antibiotics like thiolutin, mediated by bacillithiol and FAD-dependent disulfide reductases (PMID:40608363 ). Additionally, it participates in cellular responses to oxidative stress and metal acquisition, as evidenced by its biosynthesis being induced under stress conditions (PMID:40325037 ). Genetic studies have shown that bacillithiol biosynthesis is linked to the transcriptional regulation of stress-related genes, highlighting its importance in bacterial survival and competitive fitness (PMID:40085646 ). Furthermore, bacillithiol is implicated in the reduction of selenium compounds, showcasing its versatile biochemical roles (PMID:40412964 ). Overall, bacillithiol serves as a vital antioxidant and a key player in various metabolic pathways, contributing to the adaptability of Bacillus species in diverse environments.
Structure
Synonyms
ValueSource
(2S)-2-[(3-{[(2R)-2-amino-1-hydroxy-3-sulfanylpropylidene]amino}-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy]butanedioateGenerator
(2S)-2-[(3-{[(2R)-2-amino-1-hydroxy-3-sulphanylpropylidene]amino}-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy]butanedioateGenerator
(2S)-2-[(3-{[(2R)-2-amino-1-hydroxy-3-sulphanylpropylidene]amino}-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy]butanedioic acidGenerator
Molecular FormulaC13H22N2O10S
Average Mass398.38
Monoisotopic Mass398.09951609
IUPAC Name(2S)-2-[(3-{[(2R)-2-amino-1-hydroxy-3-sulfanylpropylidene]amino}-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy]butanedioic acid
Traditional Name(2S)-2-[(3-{[(2R)-2-amino-1-hydroxy-3-sulfanylpropylidene]amino}-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy]butanedioic acid
CAS Registry NumberNot Available
SMILES
[H][C@](N)(CS)C(O)=NC1([H])C([H])(O)C([H])(O)C([H])(CO)OC1([H])O[C@@]([H])(CC(O)=O)C(O)=O
InChI Identifier
InChI=1S/C13H22N2O10S/c14-4(3-26)11(21)15-8-10(20)9(19)6(2-16)25-13(8)24-5(12(22)23)1-7(17)18/h4-6,8-10,13,16,19-20,26H,1-3,14H2,(H,15,21)(H,17,18)(H,22,23)/t4-,5-,6?,8?,9?,10?,13?/m0/s1
InChI KeyUHNHELGKNQMNGF-SURZGAOXSA-N