Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 20:56:30 UTC
Update Date2025-10-07 16:04:37 UTC
Metabolite IDMMDBc0002682
Metabolite Identification
Common NamePrelactone C
DescriptionPrelactone C is a member of the chemical class of natural products known as pyranones. This metabolite has garnered attention in the field of organic chemistry due to its biological significance and potential applications. The synthesis of (+)-Prelactone C has been achieved through catalytic, asymmetric hetero Diels-Alder reactions, which demonstrate its relevance in the development of biologically important compounds (PMID:12656612 ). Additionally, these methodologies have been successfully applied to the concise syntheses of other natural derivatives, underscoring the compound's importance in medicinal chemistry (PMID:12656612 ). The precise synthesis of (+)-prelactone C has been highlighted in various studies, showcasing its potential utility in further biological investigations (PMID:11922823 ). Overall, Prelactone C serves as an intriguing subject for research, bridging the gap between synthetic organic chemistry and biological applications.
Structure
SynonymsNot Available
Molecular FormulaC9H14O3
Average Mass170.208
Monoisotopic Mass170.094294311
IUPAC Name(4R,5S,6R)-4-hydroxy-5-methyl-6-[(1E)-prop-1-en-1-yl]oxan-2-one
Traditional Name(4R,5S,6R)-4-hydroxy-5-methyl-6-[(1E)-prop-1-en-1-yl]oxan-2-one
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])[C@@]1([H])OC(=O)C[C@@]([H])(O)[C@]1([H])C
InChI Identifier
InChI=1S/C9H14O3/c1-3-4-8-6(2)7(10)5-9(11)12-8/h3-4,6-8,10H,5H2,1-2H3/b4-3+/t6-,7+,8+/m0/s1
InChI KeyUHQLZADFLWDALF-WDNVJQORSA-N