Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 21:10:01 UTC
Update Date2025-10-07 16:04:40 UTC
Metabolite IDMMDBc0002999
Metabolite Identification
Common NameOctalin
DescriptionOctalin is a bicyclic compound belonging to the class of polycyclic hydrocarbons, specifically characterized by its unique trans-decalin structure. This metabolite has garnered attention in biomedical literature due to its significant biological activities. For example, M-COPA, which incorporates an octalin skeleton, exhibits strong inhibitory effects on the growth of various cancer cell lines (PMID:40691095 ). Additionally, several diterpenes featuring an octalin framework have been isolated from the mangrove endophytic fungus Talaromyces sp., highlighting its ecological relevance (PMID:38928398 ). The total synthesis of (+)-tanzawaic acid B, which contains an octalin moiety, underscores the compound's importance in natural product chemistry (PMID:37546667 ). Furthermore, studies on octalin-forming Diels-Alderases reveal insights into the catalytic mechanisms that govern its formation (PMID:35873532 ). The structural diversity of octalin-containing natural products, including verticilactam, is also noted for their potent antibacterial activities (PMID:33206093 ). Overall, octalin serves as a crucial scaffold in various bioactive compounds, reflecting its significance in both chemical and biological contexts.
Structure
Synonyms
ValueSource
(8S,9S,10S)-8,10-Dimethyl-1-octalinMeSH
8,10-Dimethyl-1-octalinMeSH
Molecular FormulaC12H20
Average Mass164.292
Monoisotopic Mass164.156500644
IUPAC Name(1S,4aS)-1,4a-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene
Traditional Name(1S,4aS)-1,4a-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalene
CAS Registry NumberNot Available
SMILES
[H][C@]1(C)CCC[C@@]2(C)CCC=CC12[H]
InChI Identifier
InChI=1S/C12H20/c1-10-6-5-9-12(2)8-4-3-7-11(10)12/h3,7,10-11H,4-6,8-9H2,1-2H3/t10-,11?,12+/m0/s1
InChI KeyHDVGBFCTHLFNEE-ASKATJPDSA-N