Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 21:31:53 UTC
Update Date2025-10-07 16:04:44 UTC
Metabolite IDMMDBc0003515
Metabolite Identification
Common NameMiyakamide A1
DescriptionMiyakamide A1 is a peptide-like compound belonging to the class of metabolites. Its chemical structure is characterized as N-acetyl-L-phenylalanyl-N-methyl-L-phenylalanyl-(alphaZ)-alpha,beta-didehydrotryptamine, which highlights its complex arrangement of amino acids and a modified tryptamine moiety. This unique structure contributes to its potential biological activities, although specific biological functions remain less well-defined in the literature. The relationship between Miyakamide A1 and its structural isomer, Miyakamide A2, which features the E isomer of the didehydrotryptamine component, suggests a nuanced interplay of stereochemistry that may influence their respective biological properties (PMID:12546416 ). Further investigations into Miyakamide A1 may elucidate its role in metabolic pathways and its potential applications in pharmacology or biotechnology, given the increasing interest in peptide-derived compounds for therapeutic purposes.
Structure
SynonymsNot Available
Molecular FormulaC31H32N4O3
Average Mass508.622
Monoisotopic Mass508.247440906
IUPAC Name(2S)-2-[(2S)-2-[(1-hydroxyethylidene)amino]-N-methyl-3-phenylpropanamido]-N-[(Z)-2-(1H-indol-3-yl)ethenyl]-3-phenylpropanimidic acid
Traditional Name(2S)-2-[(2S)-2-[(1-hydroxyethylidene)amino]-N-methyl-3-phenylpropanamido]-N-[(Z)-2-(1H-indol-3-yl)ethenyl]-3-phenylpropanimidic acid
CAS Registry NumberNot Available
SMILES
[H]\C(N=C(O)[C@]([H])(CC1=CC=CC=C1)N(C)C(=O)[C@]([H])(CC1=CC=CC=C1)N=C(C)O)=C(/[H])C1=CNC2=CC=CC=C12
InChI Identifier
InChI=1S/C31H32N4O3/c1-22(36)34-28(19-23-11-5-3-6-12-23)31(38)35(2)29(20-24-13-7-4-8-14-24)30(37)32-18-17-25-21-33-27-16-10-9-15-26(25)27/h3-18,21,28-29,33H,19-20H2,1-2H3,(H,32,37)(H,34,36)/b18-17-/t28-,29-/m0/s1
InChI KeyNNICSBNBJLZHOU-YFZMJDHMSA-N