Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 21:33:23 UTC
Update Date2025-10-07 16:04:45 UTC
Metabolite IDMMDBc0003566
Metabolite Identification
Common NameFutalosine
DescriptionFutalosine is a metabolite classified within the chemical class of lipoic acids and their derivatives. It plays a crucial role in the biosynthesis of essential compounds such as menaquinone, pantothenate, and lipoic acids, particularly in certain bacteria that utilize the futalosine pathway instead of the canonical biosynthetic route. For instance, Helicobacter pylori, a pathogenic bacterium associated with stomach cancer, relies on this alternative pathway for menaquinone production (PMID:40175310 ). This unique metabolic route presents potential targets for antibiotic development, as beneficial intestinal bacteria, like lactobacilli, predominantly use the canonical pathway, making the futalosine pathway a promising avenue for selective inhibition (PMID:40175310 ). The first enzyme in this pathway, MqnA, catalyzes the conversion of chorismate to 3-enolpyruvyl-benzoate, highlighting the biochemical significance of futalosine in microbial metabolism (PMID:37970731 ). Additionally, various compounds, including peptaibols and specific inhibitors like FKI-8918, have been identified as modulators of the futalosine pathway, further emphasizing its relevance in both microbiology and potential therapeutic applications (PMID:40175310 ).
Structure
SynonymsNot Available
Molecular FormulaC19H18N4O7
Average Mass414.374
Monoisotopic Mass414.117548936
IUPAC Name3-{3-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-6,9-dihydro-1H-purin-9-yl)oxolan-2-yl]propanoyl}benzoic acid
Traditional Namefutalosine
CAS Registry NumberNot Available
SMILES
O[C@@H]1[C@@H](CCC(=O)C2=CC(=CC=C2)C(O)=O)O[C@H]([C@@H]1O)N1C=NC2=C1N=CNC2=O
InChI Identifier
InChI=1S/C19H18N4O7/c24-11(9-2-1-3-10(6-9)19(28)29)4-5-12-14(25)15(26)18(30-12)23-8-22-13-16(23)20-7-21-17(13)27/h1-3,6-8,12,14-15,18,25-26H,4-5H2,(H,28,29)(H,20,21,27)/t12-,14-,15-,18-/m1/s1
InChI KeyVEDWXCWBMDQNCV-SCFUHWHPSA-N