Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 21:37:36 UTC
Update Date2025-10-07 16:04:46 UTC
Metabolite IDMMDBc0003711
Metabolite Identification
Common NameDecarestrictine L
DescriptionDecarestrictine L is a natural product belonging to the class of metabolites known for their diverse biological activities. This compound has garnered attention in the field of organic chemistry due to its complex structure and the innovative synthetic pathways developed for its production. Notably, asymmetric hydroformylation-initiated tandem sequences have been employed to synthesize (+)-decarestrictine L alongside other compounds such as (+)-patulolide C and (-)-pyrenophorol, showcasing its relevance in total synthesis methodologies (PMID:25398097 ). The synthesis of decarestrictine L has been achieved using both traditional organic synthesis techniques and chemoenzymatic approaches, demonstrating its versatility and the potential for efficient production (PMID:25116794 ). Specifically, it was synthesized from the enantiomeric (4R)- and (4S)-4-(tert-butyldimethylsiloxy)-1-pentyne in a streamlined process, highlighting the compound's accessibility for further study (PMID:25398097 ). The exploration of decarestrictine L not only contributes to the understanding of its chemical properties but also opens avenues for investigating its biological significance and potential applications in pharmacology.
Structure
SynonymsNot Available
Molecular FormulaC9H16O3
Average Mass172.224
Monoisotopic Mass172.109944375
IUPAC Name1-[(2S,3R,6S)-3-hydroxy-6-methyloxan-2-yl]propan-2-one
Traditional Name1-[(2S,3R,6S)-3-hydroxy-6-methyloxan-2-yl]propan-2-one
CAS Registry NumberNot Available
SMILES
[H][C@]1(C)CC[C@@]([H])(O)[C@]([H])(CC(C)=O)O1
InChI Identifier
InChI=1S/C9H16O3/c1-6(10)5-9-8(11)4-3-7(2)12-9/h7-9,11H,3-5H2,1-2H3/t7-,8+,9-/m0/s1
InChI KeyGDXDHEIQIIZPSF-YIZRAAEISA-N