Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 22:04:36 UTC
Update Date2025-10-07 16:04:46 UTC
Metabolite IDMMDBc0003765
Metabolite Identification
Common NameIndazole-3-carbaldehyde
DescriptionIndazole-3-carbaldehyde is a chemical compound belonging to the class of indazole derivatives. It is recognized as a metabolite in various biological contexts, contributing to the complexity of metabolic pathways. The compound has been identified in studies focusing on the synthesis of novel derivatives, such as the aldol condensation product formed with bindone, which involves indazole-3-carbaldehyde and leads to intricate molecular structures through inter-molecular cyclization (PMID:30319797 ). Additionally, indazole-3-carbaldehyde has been isolated alongside other metabolites in research exploring the aqabamycin family, highlighting its presence in natural product chemistry (PMID:30319797 ). This compound, along with its derivatives, may exhibit biological activities that warrant further investigation, particularly in the realm of medicinal chemistry and pharmacology, where indazole derivatives are known for their diverse biological properties.
Structure
SynonymsNot Available
Molecular FormulaC8H6N2O
Average Mass146.149
Monoisotopic Mass146.048012821
IUPAC Name1H-indazole-3-carbaldehyde
Traditional Name1H-indazole-3-carbaldehyde
CAS Registry NumberNot Available
SMILES
O=CC1=NNC2=CC=CC=C12
InChI Identifier
InChI=1S/C8H6N2O/c11-5-8-6-3-1-2-4-7(6)9-10-8/h1-5H,(H,9,10)
InChI KeyVXOSGHMXAYBBBB-UHFFFAOYSA-N