Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:07:30 UTC
Update Date2025-10-07 16:04:47 UTC
Metabolite IDMMDBc0003863
Metabolite Identification
Common NameAAL-Toxin
DescriptionAAL-Toxin is a phytotoxin belonging to the class of polyketides, produced by certain fungal pathogens. This metabolite has garnered attention for its significant role in plant-pathogen interactions, particularly in the context of its herbicidal properties and potential applications as a bioherbicide, alongside other compounds like maculosin and tenuazonic acid (PMID:35205922 ). The pathogenicity of AAL-Toxin is closely linked to specific genetic factors in host plants, notably the Asc1 gene, which determines susceptibility in various tomato accessions (PMID:33379271 ). Studies have shown that the presence of AAL-Toxin can significantly enhance the pathogenicity of mutant pathogens by increasing cell death, hyphal penetration, and invasive spread (PMID:33922952 ). Additionally, phenotypic diversity among strains has been observed, with some lacking the AAL-toxin biosynthesis gene (ALT1) and demonstrating non-pathogenicity to their original hosts (PMID:39643392 ). This highlights the complex interplay between AAL-Toxin production and host susceptibility, making it a critical focus for understanding plant defense mechanisms and developing effective biocontrol strategies.
Structure
SynonymsNot Available
Molecular FormulaC25H47NO10
Average Mass521.648
Monoisotopic Mass521.319996717
IUPAC Name2-(2-{[(13R,14S,16S)-17-amino-5,13,14,16-tetrahydroxy-3,7-dimethylheptadecan-4-yl]oxy}-2-oxoethyl)butanedioic acid
Traditional Name2-(2-{[(13R,14S,16S)-17-amino-5,13,14,16-tetrahydroxy-3,7-dimethylheptadecan-4-yl]oxy}-2-oxoethyl)butanedioic acid
CAS Registry NumberNot Available
SMILES
[H]C(C)(CCCCC[C@@]([H])(O)[C@@]([H])(O)C[C@]([H])(O)CN)CC([H])(O)C([H])(OC(=O)CC([H])(CC(O)=O)C(O)=O)C([H])(C)CC
InChI Identifier
InChI=1S/C25H47NO10/c1-4-16(3)24(36-23(33)12-17(25(34)35)11-22(31)32)21(30)10-15(2)8-6-5-7-9-19(28)20(29)13-18(27)14-26/h15-21,24,27-30H,4-14,26H2,1-3H3,(H,31,32)(H,34,35)/t15?,16?,17?,18-,19+,20-,21?,24?/m0/s1
InChI KeyDOFQASYPBACFKP-UMSUPTIDSA-N