Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:09:06 UTC
Update Date2025-10-07 16:04:48 UTC
Metabolite IDMMDBc0003918
Metabolite Identification
Common NameNeofipiperzine C
DescriptionNeofipiperzine C is a diketopiperazine alkaloid, a chemical class known for its diverse biological activities. This compound has been identified as a metabolite derived from marine-derived fungi, specifically from the strain Penicillium brasilianum. In a study focused on isolating bioactive diketopiperazine alkaloids, researchers discovered neofipiperzine C alongside two novel related compounds, penipiperazine A and its new metabolite. The presence of neofipiperzine C in this context highlights its significance in the realm of natural products and potential pharmacological applications. Diketopiperazines, including neofipiperzine C, are of interest due to their ability to interact with various biological targets, which may lead to the development of new therapeutic agents. As research continues, understanding the specific mechanisms of action and biological effects of neofipiperzine C could provide insights into its utility in drug discovery and development. The exploration of such metabolites from marine fungi emphasizes the rich biodiversity of these organisms and their potential contributions to medicinal chemistry (PMID:38315417 ).
Structure
SynonymsNot Available
Molecular FormulaC27H35N3O6
Average Mass497.592
Monoisotopic Mass497.252585859
IUPAC Name(1R,2S,12S,15S)-1,2-dihydroxy-12-(2-hydroxy-2-methylpropyl)-7-methoxy-10-(3-methylbut-2-en-1-yl)-10,13,19-triazapentacyclo[11.7.0.0^{3,11}.0^{4,9}.0^{15,19}]icosa-3(11),4(9),5,7-tetraene-14,20-dione
Traditional Name(1R,2S,12S,15S)-1,2-dihydroxy-12-(2-hydroxy-2-methylpropyl)-7-methoxy-10-(3-methylbut-2-en-1-yl)-10,13,19-triazapentacyclo[11.7.0.0^{3,11}.0^{4,9}.0^{15,19}]icosa-3(11),4(9),5,7-tetraene-14,20-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)[C@@]1(O)N(C2=O)[C@@]([H])(CC(C)(C)O)C2=C(C3=C(C=C(OC)C=C3)N2CC=C(C)C)[C@]1([H])O
InChI Identifier
InChI=1S/C27H35N3O6/c1-15(2)10-12-28-19-13-16(36-5)8-9-17(19)21-22(28)20(14-26(3,4)34)30-24(32)18-7-6-11-29(18)25(33)27(30,35)23(21)31/h8-10,13,18,20,23,31,34-35H,6-7,11-12,14H2,1-5H3/t18-,20-,23-,27+/m0/s1
InChI KeyPHYQSJPYTFUFQL-LRAXRWESSA-N