Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:14:03 UTC
Update Date2025-10-07 16:04:49 UTC
Metabolite IDMMDBc0004082
Metabolite Identification
Common NameFredericamycin B
DescriptionFredericamycin B is a polyketide metabolite produced by the bacterium Streptomyces griseus. This compound has garnered attention due to its unique chemical structure, which was elucidated after extensive research spanning 23 years, highlighting the complexity of its biosynthesis and potential applications in medicine (PMID:15745120 ). The polyketide class is known for its diverse biological activities, and Fredericamycin B exhibits noteworthy properties that may contribute to its role in microbial ecology and potential therapeutic uses. The intricate arrangement of its molecular framework suggests that Fredericamycin B could serve as a lead compound for drug development, particularly in the search for novel antibiotics or anticancer agents. Further studies are warranted to explore its biological mechanisms and efficacy, as well as the possibility of synthetic modifications to enhance its pharmacological profile.
Structure
SynonymsNot Available
Molecular FormulaC31H23NO9
Average Mass553.523
Monoisotopic Mass553.137281325
IUPAC Name1,8,10,13,15,16-hexahydroxy-11-methoxy-3-[(1E,3E)-penta-1,3-dien-1-yl]-6,7,9,14-tetrahydro-2-azahexaphene-9,14-dione
Traditional Name1,8,10,13,15,16-hexahydroxy-11-methoxy-3-[(1E,3E)-penta-1,3-dien-1-yl]-6,7-dihydro-2-azahexaphene-9,14-dione
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])/C(/[H])=C(\[H])C1=NC(O)=C2C(O)=C3C(CCC4=C(O)C5=C(C(O)=C34)C(=O)C3=C(C(O)=C(OC)C=C3O)C5=O)=CC2=C1
InChI Identifier
InChI=1S/C31H23NO9/c1-3-4-5-6-14-10-13-9-12-7-8-15-20(18(12)27(36)19(13)31(40)32-14)28(37)24-23(25(15)34)30(39)22-21(29(24)38)16(33)11-17(41-2)26(22)35/h3-6,9-11,33-37H,7-8H2,1-2H3,(H,32,40)/b4-3+,6-5+
InChI KeyYNIOLMWTOALCPA-VNKDHWASSA-N