Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:14:27 UTC
Update Date2025-10-07 16:04:49 UTC
Metabolite IDMMDBc0004096
Metabolite Identification
Common NameAnhydrofusarubin lactol
DescriptionAnhydrofusarubin lactol is a heptaketide naphthoquinone, a chemical class known for its diverse biological activities, including antibiotic properties. This metabolite has been identified in various isolates of fungi, particularly those classified as race 1, which also produce other naphthoquinones such as nectriafurone and 5-O-methyljavanicin (PMID:12846324 ). The significance of anhydrofusarubin lactol extends to its conversion into the antibiotic bostrycoidin, highlighting its potential role in the biosynthesis of biologically active compounds (PMID:2753824 ). The study of anhydrofusarubin lactol not only contributes to our understanding of fungal metabolism but also underscores the intricate relationships between secondary metabolites and their pharmacological applications. As research progresses, the exploration of this lactol may reveal further insights into its mechanisms of action and potential therapeutic uses.
Structure
SynonymsNot Available
Molecular FormulaC15H12O7
Average Mass304.254
Monoisotopic Mass304.058302726
IUPAC Name1,6,9-trihydroxy-7-methoxy-3-methyl-1H,5H,10H-benzo[g]isochromene-5,10-dione
Traditional Name1,6,9-trihydroxy-7-methoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione
CAS Registry NumberNot Available
SMILES
COC1=C(O)C2=C(C(O)=C1)C(=O)C1=C(C=C(C)OC1O)C2=O
InChI Identifier
InChI=1S/C15H12O7/c1-5-3-6-9(15(20)22-5)14(19)10-7(16)4-8(21-2)13(18)11(10)12(6)17/h3-4,15-16,18,20H,1-2H3
InChI KeyMEEXUXCWEGTJLC-UHFFFAOYSA-N