Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:32:57 UTC
Update Date2025-10-07 16:04:54 UTC
Metabolite IDMMDBc0004626
Metabolite Identification
Common NameMeleagrin B
DescriptionMeleagrin B is a terpene-alkaloid hybrid natural product that contains both the conidiogenone and meleagrin scaffold, showcasing a unique chemical structure that combines features of both terpenes and alkaloids (PMID:33570417 ). This compound is of interest in the field of natural product chemistry due to its complex biosynthetic origins and potential biological activities. The presence of the conidiogenone scaffold suggests possible roles in fungal metabolism, while the alkaloid portion may contribute to various pharmacological properties. Preliminary studies indicate that compounds like Meleagrin B may exhibit bioactivity, although further research is needed to elucidate its mechanisms of action and therapeutic potential. The exploration of such hybrid natural products can provide insights into novel drug discovery and the development of bioactive compounds derived from natural sources. Understanding the chemistry and biological implications of Meleagrin B could lead to advancements in pharmacology and therapeutic applications, making it a subject of interest for both chemists and biologists alike.
Structure
SynonymsNot Available
Molecular FormulaC43H53N5O6
Average Mass735.926
Monoisotopic Mass735.399584447
IUPAC Name(1S,9R,14E)-11,15-dihydroxy-14-({1-[(1S,2R,3S,7S,9R,10S,11R,13R,14R)-13-hydroxy-4,4,7,10,14-pentamethyl-16-oxapentacyclo[11.2.1.0^{2,9}.0^{3,7}.0^{9,14}]hexadecan-11-yl]-1H-imidazol-4-yl}methylidene)-2-methoxy-9-(2-methylbut-3-en-2-yl)-2,13,16-triazatetracyclo[7.7.0.0^{1,13}.0^{3,8}]hexadeca-3,5,7,10,15-pentaen-12-one
Traditional Name(1S,9R,14E)-11,15-dihydroxy-14-({1-[(1S,2R,3S,7S,9R,10S,11R,13R,14R)-13-hydroxy-4,4,7,10,14-pentamethyl-16-oxapentacyclo[11.2.1.0^{2,9}.0^{3,7}.0^{9,14}]hexadecan-11-yl]imidazol-4-yl}methylidene)-2-methoxy-9-(2-methylbut-3-en-2-yl)-2,13,16-triazatetracyclo[7.7.0.0^{1,13}.0^{3,8}]hexadeca-3,5,7,10,15-pentaen-12-one
CAS Registry NumberNot Available
SMILES
[H]\C(C1=CN(C=N1)[C@]1([H])C[C@@]2(O)O[C@@]3([H])C[C@]2(C)[C@]2(C[C@]4(C)CCC(C)(C)[C@]4([H])[C@@]32[H])[C@]1([H])C)=C1/N2C(=O)C(O)=C[C@]3(C4=CC=CC=C4N(OC)[C@@]23N=C1O)C(C)(C)C=C
InChI Identifier
InChI=1S/C43H53N5O6/c1-10-37(5,6)41-19-30(49)35(51)47-28(34(50)45-43(41,47)48(53-9)27-14-12-11-13-26(27)41)17-25-21-46(23-44-25)29-18-42(52)39(8)20-31(54-42)32-33-36(3,4)15-16-38(33,7)22-40(32,39)24(29)2/h10-14,17,19,21,23-24,29,31-33,49,52H,1,15-16,18,20,22H2,2-9H3,(H,45,50)/b28-17+/t24-,29-,31+,32-,33+,38+,39-,40-,41+,42-,43+/m1/s1
InChI KeyQXXDYFVGMBQXIZ-MSHMFDJHSA-N