Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:33:22 UTC
Update Date2025-10-07 16:04:54 UTC
Metabolite IDMMDBc0004638
Metabolite Identification
Common NameBotrydial
DescriptionBotrydial is a sesquiterpenoid metabolite recognized for its role in the pathogenicity of certain fungi. It is produced by various fungal species, including Colletotrichum dematium and Botrytis cinerea, which have been shown to synthesize botrydial and its derivatives, such as dihydrobotrydial, at notable concentrations (PMID:39599324 ). The biosynthesis of botrydial is linked to specific gene clusters, including the abscisic acid (ABA)-botrydial gene cluster, which regulates virulence-related gene expression and the production of diverse metabolites (PMID:40215963 ). Additionally, studies have identified key enzymes involved in the biosynthetic pathway of botrydial, highlighting the complex interactions between fungal secondary metabolism and host plant responses (PMID:37673872 ; PMID:38791163 ). The phytotoxic effects of botrydial contribute to its classification as a virulence factor, influencing the infection process in host plants (PMID:35239739 ; PMID:34947063 ). Furthermore, synthetic methods have been developed to create compounds structurally related to botrydial, indicating its significance in both natural and synthetic chemistry (PMID:36537992 ). Overall, botrydial exemplifies the intricate relationship between fungal metabolites and their ecological roles.
Structure
SynonymsNot Available
Molecular FormulaC17H26O5
Average Mass310.39
Monoisotopic Mass310.178023937
IUPAC Name(1S,3aR,4S,6R,7S,7aS)-1,7-diformyl-7a-hydroxy-1,3,3,6-tetramethyl-octahydro-1H-inden-4-yl acetate
Traditional Namebotrydial
CAS Registry NumberNot Available
SMILES
[H][C@@]12[C@]([H])(C[C@@]([H])(C)[C@]([H])(C=O)[C@]1(O)[C@](C)(CC2(C)C)C=O)OC(C)=O
InChI Identifier
InChI=1S/C17H26O5/c1-10-6-13(22-11(2)20)14-15(3,4)8-16(5,9-19)17(14,21)12(10)7-18/h7,9-10,12-14,21H,6,8H2,1-5H3/t10-,12+,13+,14+,16-,17-/m1/s1
InChI KeySJFIYVCSGNWVPJ-GKKOWQTJSA-N