| Description | 6-deoxyerythronolide B is a polyketide, specifically a C21-macrolide backbone of erythromycin, which plays a significant role in antibiotic biosynthesis. This metabolite has garnered attention in biomedical literature for its potential significance, as highlighted in various studies (PMID:40737972 ). It is synthesized by the 6-deoxyerythronolide B synthase (DEBS), an archetypal polyketide synthase (PKS) that has been extensively studied to understand the chemistry and evolution of polyketide antibiotic biosynthesis (PMID:38663033 ). The intricate interactions between the catalytic and substrate acyl carrier protein domains of DEBS have been explored using advanced techniques such as cryogenic electron microscopy (PMID:39179672 ). Additionally, the biosynthetic pathways involving 6-deoxyerythronolide B have been engineered to produce various metabolites, showcasing its versatility in synthetic biology (PMID:36470994 ). Research has also focused on the functional characterization of antibody probes targeting specific modules of the DEBS, further elucidating its structural and functional dynamics (PMID:37184546 ). Overall, 6-deoxyerythronolide B serves as a critical model for understanding polyketide synthesis and its applications in developing antibiotic compounds. |
|---|
| InChI Identifier | InChI=1S/C21H38O6/c1-8-16-12(4)19(24)13(5)17(22)10(2)9-11(3)18(23)14(6)20(25)15(7)21(26)27-16/h10-16,18-20,23-25H,8-9H2,1-7H3/t10-,11+,12+,13+,14-,15-,16-,18+,19+,20+/m1/s1 |
|---|