Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 22:37:35 UTC
Update Date2025-10-07 16:04:55 UTC
Metabolite IDMMDBc0004776
Metabolite Identification
Common Name4-(hydroxymethyl)-5-hydroxy-2H-pyran-2-one
Description4-(hydroxymethyl)-5-hydroxy-2H-pyran-2-one is a pyranone, a class of compounds characterized by a six-membered ring containing both oxygen and carbon atoms. This compound has garnered attention in biomedical literature as a metabolite with potential biological significance. It has been isolated from various fungal sources, including Aspergillus oryzae, where it was found alongside other metabolites such as echinolactone D and 4-hydroxybenzaldehyde, indicating its role in the complex biochemical pathways of these organisms (PMID:34200759 ). Additionally, it has been identified in a marine-derived fungus, Aspergillus flavus, highlighting its occurrence in diverse ecological niches (PMID:18503205 ). The structural features of 4-(hydroxymethyl)-5-hydroxy-2H-pyran-2-one, particularly the hydroxymethyl and hydroxy groups, suggest potential reactivity and bioactivity, making it a compound of interest for further research into its pharmacological properties and ecological roles.
Structure
SynonymsNot Available
Molecular FormulaC6H6O4
Average Mass142.11
Monoisotopic Mass142.026608673
IUPAC Name5-hydroxy-4-(hydroxymethyl)-2H-pyran-2-one
Traditional Name5-hydroxy-4-(hydroxymethyl)pyran-2-one
CAS Registry NumberNot Available
SMILES
OCC1=CC(=O)OC=C1O
InChI Identifier
InChI=1S/C6H6O4/c7-2-4-1-6(9)10-3-5(4)8/h1,3,7-8H,2H2
InChI KeyYHVOEGJCPPEQKG-UHFFFAOYSA-N