Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:40:45 UTC
Update Date2025-10-07 16:04:56 UTC
Metabolite IDMMDBc0004837
Metabolite Identification
Common NamePestalotiopin B
DescriptionPestalotiopin B is a polyketide, a class of chemical compounds characterized by their biosynthesis through the polymerization of acyl-CoA precursors. This metabolite has been isolated from the ethyl acetate extracts of rice solid cultures of the mangrove endophytic fungus Pestalotiopsis sp., highlighting its potential as a secondary metabolite produced by fungi in a unique ecological niche (PMID:33511870 ). Polyketides like Pestalotiopin B are known for their diverse biological activities, which may include antimicrobial, antifungal, and cytotoxic properties, making them of interest in pharmaceutical research. The discovery of Pestalotiopin B contributes to the growing understanding of the chemical diversity generated by endophytic fungi, particularly those associated with mangrove ecosystems, which are often underexplored for their biotechnological and medicinal potential. Further studies on Pestalotiopin B could elucidate its specific biological activities and mechanisms of action, paving the way for its application in drug development and other biotechnological fields.
Structure
SynonymsNot Available
Molecular FormulaC32H49NO6
Average Mass543.745
Monoisotopic Mass543.355988302
IUPAC Name(4aS,5R)-1-(2-hydroxyethyl)-3,4a,5-trimethyl-2-oxo-1H,2H,4H,4aH,5H,6H,7H-cyclohexa[f]indol-8-yl (2S,3R,4E)-3-hydroxy-6-(hydroxymethyl)-2,4-dimethyldodec-4-enoate
Traditional Name(4aS,5R)-1-(2-hydroxyethyl)-3,4a,5-trimethyl-2-oxo-4H,5H,6H,7H-cyclohexa[f]indol-8-yl (2S,3R,4E)-3-hydroxy-6-(hydroxymethyl)-2,4-dimethyldodec-4-enoate
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\C)[C@]([H])(O)[C@]([H])(C)C(=O)OC1=C2C=C3N(CCO)C(=O)C(C)=C3C[C@@]2(C)[C@]([H])(C)CC1)C([H])(CO)CCCCCC
InChI Identifier
InChI=1S/C32H49NO6/c1-7-8-9-10-11-24(19-35)16-20(2)29(36)23(5)31(38)39-28-13-12-21(3)32(6)18-25-22(4)30(37)33(14-15-34)27(25)17-26(28)32/h16-17,21,23-24,29,34-36H,7-15,18-19H2,1-6H3/b20-16+/t21-,23+,24?,29+,32+/m1/s1
InChI KeyCCZAVWILUKHBRC-GRJCJMFWSA-N