Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 22:46:57 UTC
Update Date2025-10-07 16:04:57 UTC
Metabolite IDMMDBc0005032
Metabolite Identification
Common NameOxisterigmatocystin A
DescriptionOxisterigmatocystin A is a polyketide, a chemical class characterized by its complex structure derived from the condensation of acetyl and malonyl units. This metabolite was identified in the context of fungal secondary metabolites, specifically isolated from the deep-sea-derived fungus Aspergillus versicolor, alongside other sterigmatocystin derivatives (PMID:21119680 ). Its chemical structure and potential biological activities have garnered interest due to the presence of similar compounds known for their bioactive properties. Oxisterigmatocystin A is part of a broader family of metabolites that may exhibit various pharmacological effects, although specific biological functions remain to be fully elucidated. The compound is often studied in conjunction with other related metabolites, such as sterigmatocystin and its derivatives, which have been linked to significant biological activities, including cytotoxicity and antimicrobial effects (PMID:25038471 ). Understanding the chemistry and potential applications of oxisterigmatocystin A could provide insights into the development of new therapeutic agents derived from natural sources.
Structure
SynonymsNot Available
Molecular FormulaC20H18O8
Average Mass386.356
Monoisotopic Mass386.10016754
IUPAC Name(3S,5R,7S)-15-hydroxy-5,11,18-trimethoxy-6,8,20-trioxapentacyclo[10.8.0.0^{2,9}.0^{3,7}.0^{14,19}]icosa-1,9,11,14,16,18-hexaen-13-one
Traditional Name(3S,5R,7S)-15-hydroxy-5,11,18-trimethoxy-6,8,20-trioxapentacyclo[10.8.0.0^{2,9}.0^{3,7}.0^{14,19}]icosa-1,9,11,14,16,18-hexaen-13-one
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C[C@@]2([H])C3=C(O[C@@]2([H])O1)C=C(OC)C1=C3OC2=C(OC)C=CC(O)=C2C1=O)OC
InChI Identifier
InChI=1S/C20H18O8/c1-23-10-5-4-9(21)15-17(22)16-11(24-2)7-12-14(19(16)28-18(10)15)8-6-13(25-3)27-20(8)26-12/h4-5,7-8,13,20-21H,6H2,1-3H3/t8-,13+,20-/m0/s1
InChI KeyJOXQRCQSTGKMFA-IBXPANGUSA-N