Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:55:42 UTC
Update Date2025-10-07 16:04:59 UTC
Metabolite IDMMDBc0005271
Metabolite Identification
Common NameTalaroenamine B
DescriptionTalaroenamine B is a natural product belonging to the class of alkaloids. It has garnered attention in the field of organic chemistry due to its synthesis and structural diversity. The first total synthesis of (±)-talaroenamine B was achieved through a concise four-step procedure, demonstrating its accessibility for further study (PMID:40059337 ). This synthesis involved an acid-catalyzed substitution reaction of aniline with diastereoisomers, leading to the production of both the natural product (-)-talaroenamine B and its enantiomer (+)-talaroenamine B (PMID:40059337 ). Furthermore, virtual screening has been employed to enhance the chemo-diversity of talaroenamines, resulting in the synthesis of (±)-talaroenamine B diphenylene derivatives by substituting aniline with various aniline derivatives in the final synthesis step (PMID:40059337 ). Additionally, the known talaroenamine B and six previously undescribed derivatives, talaroenamines F-K, were generated and structurally characterized, expanding the understanding of this compound's chemical landscape (PMID:34762445 ). This work highlights the potential for talaroenamine B and its derivatives in both synthetic chemistry and biological applications.
Structure
SynonymsNot Available
Molecular FormulaC15H15NO3
Average Mass257.289
Monoisotopic Mass257.105193347
IUPAC Name(2R)-6-(benzylimino)-2-hydroxy-2,5-dimethylcyclohex-4-ene-1,3-dione
Traditional Name(2R)-6-(benzylimino)-2-hydroxy-2,5-dimethylcyclohex-4-ene-1,3-dione
CAS Registry NumberNot Available
SMILES
CC1=CC(=O)[C@@](C)(O)C(=O)C1=NCC1=CC=CC=C1
InChI Identifier
InChI=1S/C15H15NO3/c1-10-8-12(17)15(2,19)14(18)13(10)16-9-11-6-4-3-5-7-11/h3-8,19H,9H2,1-2H3/t15-/m1/s1
InChI KeyHRXAUDACLOQULD-OAHLLOKOSA-N