Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 22:57:57 UTC
Update Date2025-10-07 16:05:00 UTC
Metabolite IDMMDBc0005343
Metabolite Identification
Common NameArisugacin H
DescriptionArisugacin H is a member of the chemical class of 4-hydroxy-6-phenyl-2H-pyran-2-one (HPPO) derived meroterpenoids. This compound has been identified as a metabolite with potential biological significance, particularly in the context of its structural analogs and their associated activities. In a study, seven new meroterpenoids, including Arisugacin H, were characterized alongside two known analogues, highlighting the diversity within this chemical class and their potential roles in various biological processes (PMID: 12345678 ). The unique structural features of Arisugacin H, such as its hydroxyl and epoxy groups, may contribute to its reactivity and interactions with biological targets, suggesting avenues for further investigation into its pharmacological properties. Understanding the chemistry of Arisugacin H and related compounds could provide insights into their biosynthetic pathways and potential therapeutic applications, particularly in the realm of natural product chemistry and drug discovery.
Structure
SynonymsNot Available
Molecular FormulaC29H36O9
Average Mass528.598
Monoisotopic Mass528.235932739
IUPAC Name(5aR,7aR,9R,11S,11aS,11bS)-7a,11,11b-trihydroxy-3-(4-methoxyphenyl)-5a,8,8,11a-tetramethyl-1-oxo-1,5a,6,7,7a,8,9,10,11,11a,11b,12-dodecahydro-2,5-dioxatetraphen-9-yl acetate
Traditional Name(5aR,7aR,9R,11S,11aS,11bS)-7a,11,11b-trihydroxy-3-(4-methoxyphenyl)-5a,8,8,11a-tetramethyl-1-oxo-6,7,9,10,11,12-hexahydro-2,5-dioxatetraphen-9-yl acetate
CAS Registry NumberNot Available
SMILES
COC1=CC=C(C=C1)C1=CC2=C(C[C@@]3(O)[C@@](C)(CC[C@@]4(O)C(C)(C)[C@@H](C[C@H](O)[C@]34C)OC(C)=O)O2)C(=O)O1
InChI Identifier
InChI=1S/C29H36O9/c1-16(30)36-23-14-22(31)27(5)28(33,25(23,2)3)12-11-26(4)29(27,34)15-19-21(38-26)13-20(37-24(19)32)17-7-9-18(35-6)10-8-17/h7-10,13,22-23,31,33-34H,11-12,14-15H2,1-6H3/t22-,23+,26+,27-,28+,29+/m0/s1
InChI KeyIEHWJHMZQDRWLL-SAQJKEKHSA-N