Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:03:29 UTC
Update Date2025-10-07 16:05:01 UTC
Metabolite IDMMDBc0005455
Metabolite Identification
Common NamePenicisochroman A
DescriptionPenicisochroman A is a member of the chemical class of metabolites, specifically categorized as a furo[3,2-H]isoquinoline derivative. This compound has garnered attention in the field of natural products chemistry due to its structural complexity and potential biological activities. It has been identified alongside other notable metabolites such as pergillin and various polyketides in studies focusing on the chemical diversity of certain fungal species, including calidoustus (PMID:39590656 ). The synthetic pathways for Penicisochroman A, along with other related compounds, have been explored, revealing its formation from optically active starting materials, which highlights its relevance in synthetic organic chemistry (PMID:25906402 ). Furthermore, the synthesis of Penicisochroman A has contributed to the structural revision of other metabolites, indicating its importance in understanding the relationships and classifications within this chemical space (PMID:25906402 ). Overall, Penicisochroman A represents a significant compound within the realm of natural product research, with implications for both chemistry and potential biological applications.
Structure
SynonymsNot Available
Molecular FormulaC16H18O4
Average Mass274.316
Monoisotopic Mass274.12050906
IUPAC Name11-methoxy-11-methyl-4-(propan-2-ylidene)-3,12-dioxatricyclo[7.4.0.0²,⁶]trideca-1,6,8-trien-5-one
Traditional Name11-methoxy-11-methyl-4-(propan-2-ylidene)-3,12-dioxatricyclo[7.4.0.0²,⁶]trideca-1,6,8-trien-5-one
CAS Registry NumberNot Available
SMILES
COC1(C)CC2=CC=C3C(=O)C(OC3=C2CO1)=C(C)C
InChI Identifier
InChI=1S/C16H18O4/c1-9(2)14-13(17)11-6-5-10-7-16(3,18-4)19-8-12(10)15(11)20-14/h5-6H,7-8H2,1-4H3
InChI KeyNGRZDIKBJVTCRQ-UHFFFAOYSA-N