Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:12:40 UTC
Update Date2025-10-07 16:05:03 UTC
Metabolite IDMMDBc0005699
Metabolite Identification
Common NameKipukasin A
DescriptionKipukasin A is a natural product belonging to the class of metabolites. It has garnered attention in the field of organic chemistry due to its structural complexity and potential biological activities. The first total synthesis of kipukasin A was achieved using a practical approach that involved tetra-O-acetyl-β-D-ribose as the starting material, resulting in an overall yield of 22% (PMID:28546843 ). The synthesis process included a subsequent Vorbrüggen glycosylation, which allowed for the efficient removal of the protecting group in the presence of 5 mol % Ph3PAuOTf in dichloromethane, ultimately providing kipukasin A in high yield and regioselectivity (PMID:28546843 ). This synthetic route not only highlights the compound's intricate chemical structure but also opens avenues for further exploration of its biological properties and potential applications in medicinal chemistry.
Structure
SynonymsNot Available
Molecular FormulaC21H24N2O10
Average Mass464.427
Monoisotopic Mass464.143094981
IUPAC Name(2R,3R,4R,5R)-4-(acetyloxy)-5-(4-hydroxy-2-oxo-1,2-dihydropyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl 2,4-dimethoxy-6-methylbenzoate
Traditional Name(2R,3R,4R,5R)-4-(acetyloxy)-5-(4-hydroxy-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl 2,4-dimethoxy-6-methylbenzoate
CAS Registry NumberNot Available
SMILES
[H][C@]1(CO)O[C@@]([H])(N2C=CC(O)=NC2=O)[C@]([H])(OC(C)=O)[C@]1([H])OC(=O)C1=C(OC)C=C(OC)C=C1C
InChI Identifier
InChI=1S/C21H24N2O10/c1-10-7-12(29-3)8-13(30-4)16(10)20(27)33-17-14(9-24)32-19(18(17)31-11(2)25)23-6-5-15(26)22-21(23)28/h5-8,14,17-19,24H,9H2,1-4H3,(H,22,26,28)/t14-,17-,18-,19-/m1/s1
InChI KeyMAWCJLLSYLMLHT-UTRMSSBJSA-N