Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:16:27 UTC
Update Date2025-10-07 16:05:04 UTC
Metabolite IDMMDBc0005817
Metabolite Identification
Common NameFumiquinazoline A
DescriptionFumiquinazoline A is a fungal peptidyl alkaloid that belongs to the chemical class of alkaloids. This metabolite has garnered attention in biomedical literature for its complex biosynthesis and potential biological activities. Studies have shown that the fungus FE316 produces Fumiquinazoline A along with other metabolites when cultured with coffee husk, highlighting the influence of growth conditions on its production (PMID:40036116 ). Additionally, research utilizing liquid chromatography-mass spectrometry has revealed that mutations affecting iron metabolism can lead to reduced levels of Fumiquinazoline A, indicating its sensitivity to environmental factors (PMID:28753224 ). Among various mycotoxins, Fumiquinazoline A has been identified as a significant compound produced by certain fungal species, including Aspergillus (PMID:25737146 ). The biosynthetic pathway of Fumiquinazoline A involves the oxidation of its precursor to form more complex structures, such as fumiquinazoline C, facilitated by specific enzymes (PMID:21899262 ). Furthermore, bioinformatic analyses have identified key genetic components responsible for its biosynthesis in Aspergillus fumigatus, suggesting intricate regulatory mechanisms at play (PMID:20225828 ).
Structure
SynonymsNot Available
Molecular FormulaC24H23N5O4
Average Mass445.479
Monoisotopic Mass445.175004241
IUPAC Name(2S,9S,9aS)-9-hydroxy-9-{[(1S,4R)-3-hydroxy-1-methyl-6-oxo-1H,4H,6H-pyrazino[2,1-b]quinazolin-4-yl]methyl}-2-methyl-1H,2H,3H,9H,9aH-imidazo[1,2-a]indol-3-one
Traditional Name(2S,9S,9aS)-9-hydroxy-9-{[(1S,4R)-3-hydroxy-1-methyl-6-oxo-1H,4H-pyrazino[2,1-b]quinazolin-4-yl]methyl}-2-methyl-1H,2H,9aH-imidazo[1,2-a]indol-3-one
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)N[C@@]2([H])N(C1=O)C1=CC=CC=C1[C@@]2(O)C[C@@]1([H])N2C(=O)C3=CC=CC=C3N=C2[C@]([H])(C)N=C1O
InChI Identifier
InChI=1S/C24H23N5O4/c1-12-19-27-16-9-5-3-7-14(16)22(32)28(19)18(20(30)25-12)11-24(33)15-8-4-6-10-17(15)29-21(31)13(2)26-23(24)29/h3-10,12-13,18,23,26,33H,11H2,1-2H3,(H,25,30)/t12-,13-,18+,23-,24-/m0/s1
InChI KeyDQQCCKFZJNINST-VCPZKGNQSA-N