Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:16:32 UTC
Update Date2025-10-07 16:05:04 UTC
Metabolite IDMMDBc0005820
Metabolite Identification
Common NamePseudomycin B
DescriptionPseudomycin B is a cyclic depsinonapeptide, a chemical class characterized by a cyclic structure composed of amino acids linked by peptide bonds. This metabolite has garnered attention in the biomedical field due to its antifungal properties, particularly against pathogens like Candida and Cryptococcus. Research has focused on enhancing the therapeutic index of pseudomycin B through the synthesis of various prodrugs and analogues, with studies demonstrating improved toxicity profiles compared to the parent compound (PMID:11472220 , PMID:11459652 ). The exploration of structure-activity relationships (SAR) has led to the identification of numerous 3-amido and 8-amido derivatives of pseudomycin B, which exhibit significant in vitro and in vivo antifungal activity without causing tail vein irritation (PMID:11294388 , PMID:11206441 ). Additionally, novel derivatives such as dehydro- and dechloro-pseudomycin B have been synthesized, expanding the potential applications of this compound (PMID:10782684 ). The unique acylation patterns observed in pseudomycin B, involving specific fatty acids, further highlight its complex biochemical interactions (PMID:7957970 ). Overall, pseudomycin B represents a promising avenue for the development of new antifungal agents.
Structure
Synonyms
ValueSource
PSB CPDMeSH
Molecular FormulaC51H87ClN12O19
Average Mass1207.77
Monoisotopic Mass1206.5898963
IUPAC Name2-[(9E)-18-(4-aminobutyl)-15,24-bis(2-aminoethyl)-21-(carboxymethyl)-3-(2-chloro-1-hydroxyethyl)-27-[(1,3-dihydroxytetradecylidene)amino]-9-ethylidene-5,8,11,14,17,20,23,26-octahydroxy-12-(1-hydroxyethyl)-2-oxo-1-oxa-4,7,10,13,16,19,22,25-octaazacyclooctacosa-4,7,10,13,16,19,22,25-octaen-6-yl]-2-hydroxyacetic acid
Traditional Name[(9E)-18-(4-aminobutyl)-15,24-bis(2-aminoethyl)-21-(carboxymethyl)-3-(2-chloro-1-hydroxyethyl)-27-[(1,3-dihydroxytetradecylidene)amino]-9-ethylidene-5,8,11,14,17,20,23,26-octahydroxy-12-(1-hydroxyethyl)-2-oxo-1-oxa-4,7,10,13,16,19,22,25-octaazacyclooctacosa-4,7,10,13,16,19,22,25-octaen-6-yl](hydroxy)acetic acid
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C1/N=C(O)C(N=C(O)C(CCN)N=C(O)C(CCCCN)N=C(O)C(CC(O)=O)N=C(O)C(CCN)N=C(O)C(COC(=O)C(N=C(O)C(N=C1O)C(O)C(O)=O)C(O)CCl)N=C(O)CC(O)CCCCCCCCCCC)C(C)O
InChI Identifier
InChI=1S/C51H87ClN12O19/c1-4-6-7-8-9-10-11-12-13-16-28(66)23-36(68)56-34-26-83-51(82)39(35(67)25-52)63-49(79)40(41(71)50(80)81)64-42(72)29(5-2)57-48(78)38(27(3)65)62-45(75)32(19-22-55)59-43(73)30(17-14-15-20-53)58-46(76)33(24-37(69)70)61-44(74)31(18-21-54)60-47(34)77/h5,27-28,30-35,38-41,65-67,71H,4,6-26,53-55H2,1-3H3,(H,56,68)(H,57,78)(H,58,76)(H,59,73)(H,60,77)(H,61,74)(H,62,75)(H,63,79)(H,64,72)(H,69,70)(H,80,81)/b29-5+
InChI KeyNYRWZRIVFVWNTD-IMUCOVGGSA-N