Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 23:20:46 UTC
Update Date2025-10-07 16:05:05 UTC
Metabolite IDMMDBc0005915
Metabolite Identification
Common Name5-deoxybostrycoidin
Description5-deoxybostrycoidin is a secondary metabolite belonging to the class of polyketides. It has been identified in various fungal species, particularly those associated with endophytic lifestyles. This compound was isolated from the endophytic fungus Lophiostoma sp. alongside other metabolites, highlighting its occurrence in diverse fungal ecosystems (PMID:34044780 ). Additionally, it was found among several new alkaloids from Diaporthe phaseolorum SKS019, indicating its potential significance in fungal chemistry (PMID:28119026 ). Notably, 5-deoxybostrycoidin is implicated in the pigmentation of black perithecia in Fusarium species, where it contributes to the formation of melanin, a critical factor for fungal survival and pathogenicity (PMID:27193384 ). The over-expression of specific genes in Fusarium has been linked to the production of 5-deoxybostrycoidin and its derivatives, further underscoring its biological relevance (PMID:27193384 ). The presence of this compound in fruiting bodies suggests it plays a role in the ecological interactions of fungi, potentially influencing their adaptability and interactions with hosts or environments.
Structure
SynonymsNot Available
Molecular FormulaC15H11NO4
Average Mass269.256
Monoisotopic Mass269.068807838
IUPAC Name9-hydroxy-7-methoxy-3-methyl-5H,10H-benzo[g]isoquinoline-5,10-dione
Traditional Name9-hydroxy-7-methoxy-3-methylbenzo[g]isoquinoline-5,10-dione
CAS Registry NumberNot Available
SMILES
COC1=CC(O)=C2C(=O)C3=CN=C(C)C=C3C(=O)C2=C1
InChI Identifier
InChI=1S/C15H11NO4/c1-7-3-9-11(6-16-7)15(19)13-10(14(9)18)4-8(20-2)5-12(13)17/h3-6,17H,1-2H3
InChI KeyRGUUYFLCINGWMZ-UHFFFAOYSA-N