Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 23:20:49 UTC
Update Date2025-10-07 16:05:05 UTC
Metabolite IDMMDBc0005917
Metabolite Identification
Common Name(-)-6-deoxyoxysporidinone
Description(-)-6-deoxyoxysporidinone is a secondary metabolite belonging to the class of polyketides, specifically derived from fungal sources. It has been identified in the culture broth of various Fusarium species, highlighting its potential significance in the context of fungal metabolism and bioactivity. This compound was isolated alongside other known metabolites such as sambutoxin and N-demethylsambutoxin, indicating its relevance in the complex chemical profiles of these fungi (PMID:31204387 ). Additionally, (-)-6-deoxyoxysporidinone was obtained through wound-healing assay-guided fractionation from the endophytic fungus Fusarium oxysporum, which underscores its potential biological activity and therapeutic implications (PMID:17286429 ). The structural characteristics and biological properties of (-)-6-deoxyoxysporidinone warrant further investigation, particularly in relation to its role in wound healing and other pharmacological applications, given its origin from a well-studied genus known for producing bioactive compounds.
Structure
SynonymsNot Available
Molecular FormulaC28H43NO5
Average Mass473.654
Monoisotopic Mass473.314123489
IUPAC Name3-[(2S,5R,6R)-6-[(2E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-5-(1-hydroxy-4-oxocyclohexyl)-1-methyl-1,2-dihydropyridin-2-one
Traditional Name3-[(2S,5R,6R)-6-[(2E)-4,6-dimethyloct-2-en-2-yl]-5-methyloxan-2-yl]-4-hydroxy-5-(1-hydroxy-4-oxocyclohexyl)-1-methylpyridin-2-one
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\C)[C@]1([H])O[C@@]([H])(CC[C@@]1([H])C)C1=C(O)C(=CN(C)C1=O)C1(O)CCC(=O)CC1)C([H])(C)CC([H])(C)CC
InChI Identifier
InChI=1S/C28H43NO5/c1-7-17(2)14-18(3)15-20(5)26-19(4)8-9-23(34-26)24-25(31)22(16-29(6)27(24)32)28(33)12-10-21(30)11-13-28/h15-19,23,26,31,33H,7-14H2,1-6H3/b20-15+/t17?,18?,19-,23+,26-/m1/s1
InChI KeyHCEYJWLXDYOMJQ-ZYZGZXMFSA-N