Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:21:47 UTC
Update Date2025-10-07 16:05:05 UTC
Metabolite IDMMDBc0005947
Metabolite Identification
Common NameMarcfortine C
DescriptionMarcfortine C is a fungal metabolite belonging to the class of natural products known as alkaloids. This compound has garnered attention in the field of medicinal chemistry due to its potential as a drug candidate. Recent advancements in synthetic methodologies have facilitated the asymmetric synthesis of (-)-marcfortine C, showcasing innovative approaches to constructing complex heterocycles with multiple functional groups in a highly efficient manner (PMID:32525684 ). The first asymmetric synthesis of this compound has been documented, further emphasizing its significance in drug development (PMID:24083654 ). Notably, a biomimetic total synthesis of d,l-marcfortine C has been achieved, employing an intramolecular Diels-Alder reaction, which highlights the intricate relationship between synthetic chemistry and natural product synthesis (PMID:18596842 ). These studies underline the importance of Marcfortine C not only as a target for total synthesis but also as a valuable model for exploring new synthetic strategies that can lead to the discovery of novel therapeutic agents.
Structure
SynonymsNot Available
Molecular FormulaC27H33N3O3
Average Mass447.579
Monoisotopic Mass447.252191935
IUPAC Name(1'S,3R,8'S,10'R)-7,7,11',11'-tetramethyl-7H-3',14'-diazaspiro[chromeno[5,6-b]pyrrole-3,12'-tetracyclo[6.5.2.0^{1,10}.0^{3,8}]pentadecan]-14'-ene-2,15'-diol
Traditional Name(1'S,3R,8'S,10'R)-7,7,11',11'-tetramethyl-3',14'-diazaspiro[chromeno[5,6-b]pyrrole-3,12'-tetracyclo[6.5.2.0^{1,10}.0^{3,8}]pentadecan]-14'-ene-2,15'-diol
CAS Registry NumberNot Available
SMILES
[H][C@]12C[C@]34CCCCN3C[C@@]1(C[C@@]1(C(O)=NC3=C1C=CC1=C3C=CC(C)(C)O1)C2(C)C)N=C4O
InChI Identifier
InChI=1S/C27H33N3O3/c1-23(2)11-9-16-18(33-23)8-7-17-20(16)28-22(32)27(17)14-25-15-30-12-6-5-10-26(30,21(31)29-25)13-19(25)24(27,3)4/h7-9,11,19H,5-6,10,12-15H2,1-4H3,(H,28,32)(H,29,31)/t19-,25-,26+,27-/m1/s1
InChI KeyMEDWEEBWLKOHES-ABMOCFRJSA-N