Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 23:27:34 UTC
Update Date2025-10-07 16:05:07 UTC
Metabolite IDMMDBc0006120
Metabolite Identification
Common Namemethoxy-xanthocillin X dimethylether
Descriptionmethoxy-xanthocillin X dimethylether is a member of the xanthocillin chemical class, specifically categorized as a metabolite. This compound has garnered attention in biomedical literature for its potential antiviral properties, as evidenced by studies highlighting its role alongside other derivatives such as xanthocillin X mono- and dimethylether. The research indicates that methoxy-xanthocillin X dimethylether exhibits significant activity against various pathogens, suggesting its utility in the development of new antiviral antibiotics (PMID:5752383 ). Further investigations have reinforced its relevance in the search for effective antimicrobial agents, showcasing its structural modifications that enhance biological activity (PMID:4304616 ). The unique chemical structure of methoxy-xanthocillin X dimethylether contributes to its pharmacological profile, making it a compound of interest in both chemistry and biology for the ongoing fight against resistant infections.
Structure
SynonymsNot Available
Molecular FormulaC21H18N2O3
Average Mass346.386
Monoisotopic Mass346.131742448
IUPAC Name4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dien-1-yl]-1,2-dimethoxybenzene
Traditional Name4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dien-1-yl]-1,2-dimethoxybenzene
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[N+]#[C-])/C(/[N+]#[C-])=C(\[H])C1=CC(OC)=C(OC)C=C1)C1=CC=C(OC)C=C1
InChI Identifier
InChI=1S/C21H18N2O3/c1-22-18(12-15-6-9-17(24-3)10-7-15)19(23-2)13-16-8-11-20(25-4)21(14-16)26-5/h6-14H,3-5H3/b18-12-,19-13-
InChI KeyGTCYCSHLUXYSAO-BKHHGCLFSA-N