Record Information
Version1.0
StatusDetected and Quantified
Creation Date2021-05-14 23:31:07 UTC
Update Date2025-10-07 16:05:07 UTC
Metabolite IDMMDBc0006200
Metabolite Identification
Common NameNotoamide E
DescriptionNotoamide E is a secondary metabolite belonging to the class of prenylated indole alkaloids. It is primarily produced by fungi of the genus Aspergillus and serves as a crucial biosynthetic intermediate in the formation of various advanced metabolites. The compound is generated through a series of chemical transformations, including aldol condensation, nucleophilic reduction, and epoxidation, ultimately leading to the synthesis of notoamide C and the indole fragmentation product amoenamide E (PMID:39180143 ). Its role as a precursor has been substantiated by studies demonstrating its incorporation into notoamides C and D in cultures of Aspergillus versicolor (PMID:22140279 ). Additionally, the enzyme NotB catalyzes the indole 2,3-oxidation of notoamide E, facilitating its conversion into other notable metabolites (PMID:22188465 ). The significance of notoamide E extends to its proposed involvement in the biosynthetic pathways of various natural products, as evidenced by the incorporation of synthetic labeled notoamide E into metabolic analyses (PMID:22140279 ). Overall, notoamide E exemplifies the intricate chemistry and biological relevance of indole alkaloids in fungal metabolism (PMID:19292484 ).
Structure
SynonymsNot Available
Molecular FormulaC26H31N3O3
Average Mass433.552
Monoisotopic Mass433.23654187
IUPAC Name(3S,8aS)-3-{[7,7-dimethyl-2-(2-methylbut-3-en-2-yl)-1H,7H-chromeno[5,6-b]pyrrol-3-yl]methyl}-1-hydroxy-3H,4H,6H,7H,8H,8aH-pyrrolo[1,2-a]pyrazin-4-one
Traditional Name(3S,8aS)-3-{[7,7-dimethyl-2-(2-methylbut-3-en-2-yl)-1H-chromeno[5,6-b]pyrrol-3-yl]methyl}-1-hydroxy-3H,6H,7H,8H,8aH-pyrrolo[1,2-a]pyrazin-4-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)[C@]([H])(CC1=C(NC3=C1C=CC1=C3C=CC(C)(C)O1)C(C)(C)C=C)N=C2O
InChI Identifier
InChI=1S/C26H31N3O3/c1-6-25(2,3)22-17(14-18-24(31)29-13-7-8-19(29)23(30)27-18)15-9-10-20-16(21(15)28-22)11-12-26(4,5)32-20/h6,9-12,18-19,28H,1,7-8,13-14H2,2-5H3,(H,27,30)/t18-,19-/m0/s1
InChI KeyFQFSPHHVEQZCED-OALUTQOASA-N