Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:31:16 UTC
Update Date2025-10-07 16:05:07 UTC
Metabolite IDMMDBc0006204
Metabolite Identification
Common NameFiciolide K
DescriptionFiciolide K is a metabolite belonging to the class of natural products, specifically characterized by its unique chemical structure. It features a very rare 1,6-anhydro-pyranose moiety, which contributes to its distinct biochemical properties (PMID:27015125 ). This structural characteristic may influence its biological activity, potentially affecting metabolic pathways in organisms that produce or interact with it. The exploration of Ficiolide K's chemical properties and its biological implications could provide insights into its role in natural processes and its potential applications in pharmacology or biotechnology. As research continues to uncover the complexities of such metabolites, Ficiolide K stands out as a compound of interest for further investigation into its synthesis, function, and utility in various scientific fields.
Structure
SynonymsNot Available
Molecular FormulaC14H22O7
Average Mass302.323
Monoisotopic Mass302.136553048
IUPAC Name2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl (7R)-7-hydroxyoct-2-enoate
Traditional Name2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl (7R)-7-hydroxyoct-2-enoate
CAS Registry NumberNot Available
SMILES
[H][C@](C)(O)CCCC=CC(=O)OC1([H])C([H])(O)C2([H])COC([H])(O2)C1([H])O
InChI Identifier
InChI=1S/C14H22O7/c1-8(15)5-3-2-4-6-10(16)21-13-11(17)9-7-19-14(20-9)12(13)18/h4,6,8-9,11-15,17-18H,2-3,5,7H2,1H3/t8-,9?,11?,12?,13?,14?/m1/s1
InChI KeyVHYHVKOVKKLPQI-LLSZIJKQSA-N