Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:39:28 UTC
Update Date2025-10-07 16:05:10 UTC
Metabolite IDMMDBc0006459
Metabolite Identification
Common NameAsperfuran
DescriptionAsperfuran is a dihydrobenzofuran derivative belonging to the class of antifungal metabolites. It has been identified in various fungal species, including Aspergillus oryzae, where it exhibits antifungal properties, weakly inhibiting chitin synthase from Coprinus cinereus (PMID:2143181 ). Additionally, asperfuran has been isolated from the psychrotolerant fungus Penicillium ribium, alongside other compounds like kojic acid (PMID:16738124 ). The compound has also been reported in the context of Cordyceps javanica, where a new glycosylated form of asperfuran was discovered, highlighting its potential as a bioactive agent (PMID:31921369 ). Notably, asperfuran has shown the ability to induce morphological changes in Mucor miehei at low concentrations, although it only partially inhibited growth (PMID:2143181 ). Its diverse presence across different fungal species suggests a significant role in their secondary metabolite profiles, which may contribute to their ecological interactions and potential applications in biotechnology and medicine. Overall, asperfuran represents a fascinating example of the complex chemistry and biological activity found within fungal metabolites.
Structure
SynonymsNot Available
Molecular FormulaC13H14O3
Average Mass218.252
Monoisotopic Mass218.094294311
IUPAC Name(2R)-2-[(1E,3E)-penta-1,3-dien-1-yl]-2,3-dihydro-1-benzofuran-5,7-diol
Traditional Name(2R)-2-[(1E,3E)-penta-1,3-dien-1-yl]-2,3-dihydro-1-benzofuran-5,7-diol
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])/C(/[H])=C(\[H])[C@@]1([H])CC2=CC(O)=CC(O)=C2O1
InChI Identifier
InChI=1S/C13H14O3/c1-2-3-4-5-11-7-9-6-10(14)8-12(15)13(9)16-11/h2-6,8,11,14-15H,7H2,1H3/b3-2+,5-4+/t11-/m0/s1
InChI KeyWTFIFQXTQCYJKU-JWVODRKRSA-N