Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:41:42 UTC
Update Date2025-10-07 16:05:11 UTC
Metabolite IDMMDBc0006526
Metabolite Identification
Common NamePenicisochroman B
DescriptionPenicisochroman B is a member of the chemical class of chromans, which are characterized by a chromane core structure. This compound has garnered attention in the field of natural products chemistry due to its unique structural features and potential biological activities. Recent studies have reported the syntheses of penicisochroman B alongside other related metabolites, highlighting its significance in the context of natural product research (PMID:24033077 ). Additionally, the determination of the absolute configuration of penicisochroman B has provided insights into its stereochemical properties, which are crucial for understanding its biological interactions and potential pharmacological effects (PMID:24033077 ). As a metabolite, penicisochroman B may play a role in various biological processes, although further research is needed to elucidate its specific functions and applications in medicinal chemistry.
Structure
SynonymsNot Available
Molecular FormulaC16H20O4
Average Mass276.332
Monoisotopic Mass276.136159124
IUPAC Name(11S,13R)-13-methoxy-11-methyl-4-(propan-2-yl)-3,12-dioxatricyclo[7.4.0.0^{2,6}]trideca-1(9),2(6),7-trien-5-one
Traditional Name(11S,13R)-4-isopropyl-13-methoxy-11-methyl-3,12-dioxatricyclo[7.4.0.0^{2,6}]trideca-1(9),2(6),7-trien-5-one
CAS Registry NumberNot Available
SMILES
[H]C1(OC2=C(C=CC3=C2[C@]([H])(OC)O[C@@]([H])(C)C3)C1=O)C(C)C
InChI Identifier
InChI=1S/C16H20O4/c1-8(2)14-13(17)11-6-5-10-7-9(3)19-16(18-4)12(10)15(11)20-14/h5-6,8-9,14,16H,7H2,1-4H3/t9-,14?,16+/m0/s1
InChI KeyOOXIYCFKVAWYJC-NEVUNZDHSA-N