Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-14 23:43:58 UTC
Update Date2025-10-07 16:05:12 UTC
Metabolite IDMMDBc0006601
Metabolite Identification
Common NameSorbicillactone B
DescriptionSorbicillactone B is a novel-type alkaloid belonging to the chemical class of fungal metabolites. It was identified during research aimed at discovering new bioactive compounds from sponge-derived microorganisms, highlighting its potential significance in natural product chemistry. The structure and biosynthetic pathway of sorbicillactone B are unprecedented, which adds to the intrigue surrounding its chemical properties and biological activities. Such metabolites are often of interest due to their potential pharmacological applications, including antimicrobial and anticancer properties. The discovery of sorbicillactone B, alongside its counterpart sorbicillactone A, underscores the rich biodiversity of marine ecosystems and the importance of exploring these environments for novel compounds that may contribute to drug development and other biotechnological applications (PMID:18463724 ).
Structure
SynonymsNot Available
Molecular FormulaC21H25NO8
Average Mass419.43
Monoisotopic Mass419.158016769
IUPAC Name(2E)-3-{[(3S,3aR,7aS)-4-[(4E)-hex-4-enoyl]-5,7-dihydroxy-3,6,7a-trimethyl-2-oxo-2,3,3a,7a-tetrahydro-1-benzofuran-3-yl]-C-hydroxycarbonimidoyl}prop-2-enoic acid
Traditional Name(2E)-3-{[(3S,3aR,7aS)-4-[(4E)-hex-4-enoyl]-5,7-dihydroxy-3,6,7a-trimethyl-2-oxo-3aH-1-benzofuran-3-yl]-C-hydroxycarbonimidoyl}prop-2-enoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])CCC(=O)C1=C(O)C(C)=C(O)[C@@]2(C)OC(=O)[C@@](C)(N=C(O)C(\[H])=C(/[H])C(O)=O)[C@@]12[H]
InChI Identifier
InChI=1S/C21H25NO8/c1-5-6-7-8-12(23)15-16(27)11(2)18(28)21(4)17(15)20(3,19(29)30-21)22-13(24)9-10-14(25)26/h5-6,9-10,17,27-28H,7-8H2,1-4H3,(H,22,24)(H,25,26)/b6-5+,10-9+/t17-,20+,21+/m1/s1
InChI KeyFBHQVVAZJLEQBG-NVZCPQDISA-N