Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:12:57 UTC
Update Date2025-10-07 16:05:14 UTC
Metabolite IDMMDBc0006822
Metabolite Identification
Common Name3-Chloro-4-(3-chloro-2-nitrophenyl)-5-methoxy-3-pyrrolin-2-one
Description3-Chloro-4-(3-chloro-2-nitrophenyl)-5-methoxy-3-pyrrolin-2-one is a pyrrolinone derivative, a chemical class known for its diverse biological activities. This compound was identified as a metabolite in a study focused on antifungal compounds derived from the fermentation extracts of the soil-borne bacterium Burkholderia cepacia K87. The research highlighted the compound alongside other analogs, emphasizing its potential as an antifungal agent (PMID:18776654 ). Pyrrolinones, including this specific derivative, have garnered interest due to their structural features that may contribute to various pharmacological effects, including antifungal properties. The presence of chloro and nitro substituents in its structure suggests potential interactions with biological targets, which could be explored further for therapeutic applications. Overall, 3-chloro-4-(3-chloro-2-nitrophenyl)-5-methoxy-3-pyrrolin-2-one represents a promising candidate for further investigation in the field of medicinal chemistry and microbiology.
Structure
SynonymsNot Available
Molecular FormulaC11H8Cl2N2O4
Average Mass303.1
Monoisotopic Mass301.9861121
IUPAC Name3-chloro-4-(3-chloro-2-nitrophenyl)-5-methoxy-2,5-dihydro-1H-pyrrol-2-one
Traditional Name3-chloro-4-(3-chloro-2-nitrophenyl)-5-methoxy-1,5-dihydropyrrol-2-one
CAS Registry NumberNot Available
SMILES
COC1NC(=O)C(Cl)=C1C1=C(C(Cl)=CC=C1)N(=O)=O
InChI Identifier
InChI=1S/C11H8Cl2N2O4/c1-19-11-7(8(13)10(16)14-11)5-3-2-4-6(12)9(5)15(17)18/h2-4,11H,1H3,(H,14,16)
InChI KeyJBJAISKDFNUTNB-UHFFFAOYSA-N