Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:16:14 UTC
Update Date2025-10-07 16:05:15 UTC
Metabolite IDMMDBc0006910
Metabolite Identification
Common NameCochlioquinone B
DescriptionCochlioquinone B is a member of the terpenoid chemical class, specifically a natural product with notable biological activities. It has been synthesized alongside other terpenoid compounds, highlighting its structural significance in the realm of natural products (PMID:40523914 ). The compound is part of a diverse family of cochlioquinones, which includes unique structural variants such as bipolacochlioquinone A and B, characterized by their complex pentacyclic systems (PMID:35427653 ). Cochlioquinone B and its derivatives, particularly CoB1, have been isolated from the endophytic fungus Bipolaris sorokiniana found in Salvia miltiorrhiza, where they play a crucial role in modulating inflammatory responses and enhancing host defense against pulmonary pathogens (PMID:34624808 , PMID:32747503 ). Furthermore, Cochlioquinone B exhibits antimicrobial properties, demonstrating activity against methicillin-resistant Staphylococcus aureus (MRSA) and showing synergistic effects against other pathogens (PMID:32215711 ). Its isolation alongside other known compounds further underscores its relevance in the study of bioactive natural products (PMID:11908970 ).
Structure
SynonymsNot Available
Molecular FormulaC28H40O6
Average Mass472.622
Monoisotopic Mass472.282489008
IUPAC Name(2R,4aR,10aR,12aR)-2-(2-hydroxypropan-2-yl)-4a,10a-dimethyl-8-[(2S,4S)-4-methyl-3-oxohexan-2-yl]-2,3,4,4a,4b,5,6,9,10a,11,12,12a-dodecahydro-1,10-dioxatetraphene-6,9-dione
Traditional Name(2R,4aR,10aR,12aR)-2-(2-hydroxypropan-2-yl)-4a,10a-dimethyl-8-[(2S,4S)-4-methyl-3-oxohexan-2-yl]-2,3,4,4b,5,11,12,12a-octahydro-1,10-dioxatetraphene-6,9-dione
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC)C(=O)[C@@]([H])(C)C1=CC(=O)C2=C(O[C@]3(C)CC[C@@]4([H])O[C@]([H])(CC[C@]4(C)C3([H])C2)C(C)(C)O)C1=O
InChI Identifier
InChI=1S/C28H40O6/c1-8-15(2)23(30)16(3)17-13-19(29)18-14-20-27(6)11-9-21(26(4,5)32)33-22(27)10-12-28(20,7)34-25(18)24(17)31/h13,15-16,20-22,32H,8-12,14H2,1-7H3/t15-,16-,20?,21+,22+,27+,28+/m0/s1
InChI KeyNTPNSKLZWVYKGK-DMBAJPFZSA-N