Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 00:32:35 UTC
Update Date2025-10-07 16:05:18 UTC
Metabolite IDMMDBc0007311
Metabolite Identification
Common NameDebromomarinone
DescriptionDebromomarinone is a naphthoquinone-derived meroterpenoid, a chemical class that encompasses compounds combining both terpenoid and non-terpenoid structures. This metabolite has garnered attention in biomedical research due to its intriguing synthesis and biological implications. The total synthesis of debromomarinone was achieved through a series of pericyclic reactions, including an aromatic Claisen rearrangement and Diels-Alder reactions, highlighting its synthetic accessibility and structural complexity (PMID:31549845 ). In investigations of the strain CNQ-509, debromomarinone was isolated alongside novel naphterpin derivatives, further emphasizing its relevance in natural product chemistry (PMID:29534540 ). Additionally, the enzyme CnqP3, associated with the biosynthesis of tetrahydroxynaphthalene-derived natural products, has been implicated in the formation of debromomarinone, suggesting a biosynthetic pathway that contributes to its natural occurrence (PMID:26659564 ). The compound is also mentioned in the context of various other bioactive substances, indicating its potential significance in pharmacological research (PMID:7710421 ). Overall, debromomarinone represents a fascinating intersection of chemistry and biology, warranting further exploration of its properties and applications.
Structure
SynonymsNot Available
Molecular FormulaC25H28O5
Average Mass408.494
Monoisotopic Mass408.193674002
IUPAC Name(4aR,5S,12bS)-8,10-dihydroxy-2,5-dimethyl-5-(4-methylpent-3-en-1-yl)-4,4a,5,7,12,12b-hexahydro-3H-6-oxatetraphene-7,12-dione
Traditional Name(4aR,5S,12bS)-8,10-dihydroxy-2,5-dimethyl-5-(4-methylpent-3-en-1-yl)-3,4,4a,12b-tetrahydro-6-oxatetraphene-7,12-dione
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCC(C)=C[C@]1([H])C1=C(O[C@@]2(C)CCC=C(C)C)C(=O)C2=C(C=C(O)C=C2O)C1=O
InChI Identifier
InChI=1S/C25H28O5/c1-13(2)6-5-9-25(4)18-8-7-14(3)10-16(18)21-22(28)17-11-15(26)12-19(27)20(17)23(29)24(21)30-25/h6,10-12,16,18,26-27H,5,7-9H2,1-4H3/t16-,18+,25-/m0/s1
InChI KeyDPALYVVGGATILJ-UVNWJPITSA-N